| Identification | Back Directory | [Name]
TRIMETHYL(2,3,4,5-TETRAMETHYL-2,4-CYCLOPENTADIEN-1-YL)SILANE | [CAS]
134695-74-2 | [Synonyms]
TMCP-TMS Tetramethylcyclopentadienyltrimethylsilane 2,3,4,5-TETRAMETHYLCYCLOPENTADIENYLTRIMETHYLSILANE 2,3,4,5-Tetramethylcyclopentadien-1-yltrimethylsilane 2,3,4,5-TETRAMETHYLCYCLOPENTADIEN-1-3-YLTRIMETHYLSILANE 1,2,3,4-tetramethyl-5-(trimethylsilyl)-1,3-Cyclopentadiene Trimethyl(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane TRIMETHYL(1,2,3,4-TETRAMETHYL-2,4-CYCLOPENTADIEN-1-YL)SILANE TRIMETHYL(2,3,4,5-TETRAMETHYL-2,4-CYCLOPENTADIEN-1-YL)SILANE 1,3-Cyclopentadiene, 1,2,3,4-tetramethyl-5-(trimethylsilyl)- trimethyl-(2,3,4,5-tetramethyl-1-cyclopenta-2,4-dienyl)silane (2,3,4,5-Tetramethyl-2,4-cyclopentadiene-1-yl)-trimethylsilane TriMethyl(2,3,4,5-tetraMethyl-2,4-cyclopentadien-1-yl)silane 97% | [Molecular Formula]
C12H22Si | [MDL Number]
MFCD00674076 | [MOL File]
134695-74-2.mol | [Molecular Weight]
194.39 |
| Chemical Properties | Back Directory | [Boiling point ]
45°C 0,03mm | [density ]
0,852 g/cm3 | [refractive index ]
1.4860 | [Fp ]
73°C | [storage temp. ]
Sealed in dry,Room Temperature | [Specific Gravity]
0.852 | [Appearance]
Colorless to light yellow Liquid | [Hydrolytic Sensitivity]
4: no reaction with water under neutral conditions | [InChI]
1S/C12H22Si/c1-8-9(2)11(4)12(10(8)3)13(5,6)7/h12H,1-7H3 | [InChIKey]
VEUUNIUMKJTBJB-UHFFFAOYSA-N | [SMILES]
CC1=C(C)C(C)=C(C)C1[Si](C)(C)C |
| Hazard Information | Back Directory | [Uses]
Trimethyl(2,3,4,5-tetramethyl-2,4-cyclopentadien-1-yl)silane may be used for the synthesis of aryl/heteroarylpiperazine derivatives. |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Domole Scientific
|
| Telephone: |
13275595566; 13275595566 |
| Website: |
http://www.domole.com/ |
|