| Identification | More | [Name]
2,5-PYRIDINEDICARBOXYLIC ACID DI-N-PROPYL ESTER | [CAS]
136-45-8 | [Synonyms]
2,5-PYRIDINEDICARBOXYLIC ACID DI-N-PROPYL ESTER DIISOPROPYL 2,5-PYRIDINDICARBOXYLATE DI-N-PROPYL 2,5-PYRIDINEDICARBOXYLATE DI-N-PROPYL ISOCINCHOMERONATE DIPROPYL ISOCINCHOMERONATE ISOCINCHOMERONIC ACID DI-N-PROPYL ESTER MGK 326 MGK 326 (TM) MGK REPELLENT 326(R) 2,5-pyridinedicarboxylicacid,dipropylester dipropyl2,5-pyridinedicarboxylate dipropylesterkyselinypyridin-2,5-dikarboxylove dipropylpyridine-2,5-dicarboxylate ent17595 isocinchomeronyldipropylester mgkr-326 mgkrepellent-326 pyridin-2,5-dicarbonsaeure-di-n-propylester r-326 repper333 | [EINECS(EC#)]
205-245-9 | [Molecular Formula]
C13H17NO4 | [MDL Number]
MFCD00055315 | [Molecular Weight]
251.28 | [MOL File]
136-45-8.mol |
| Chemical Properties | Back Directory | [Boiling point ]
175 °C / 5mmHg | [density ]
1.12 | [refractive index ]
1.4990 to 1.5010 | [Fp ]
93.4 °C | [storage temp. ]
0-6°C | [Water Solubility ]
Insoluble in water | [form ]
neat | [pka]
-0.23±0.10(Predicted) | [color ]
Colorless to Yellow to Green | [BRN ]
229600 | [Cosmetics Ingredients Functions]
ANTIMICROBIAL | [InChI]
InChI=1S/C13H17NO4/c1-3-7-17-12(15)10-5-6-11(14-9-10)13(16)18-8-4-2/h5-6,9H,3-4,7-8H2,1-2H3 | [InChIKey]
IITCWRFYJWUUPC-UHFFFAOYSA-N | [SMILES]
C1(C(OCCC)=O)=NC=C(C(OCCC)=O)C=C1 | [LogP]
3.570 | [CAS DataBase Reference]
136-45-8(CAS DataBase Reference) | [EPA Substance Registry System]
Dipropyl isocinchomeronate (136-45-8) |
| Hazard Information | Back Directory | [General Description]
A solid. | [Production Methods]
Di-n-propyl isocinchomeronate is synthesised through an esterification reaction between isocinchomeronic acid and n-propyl alcohol. The process typically involves heating the acid with an excess of n-propyl alcohol in the presence of an acid catalyst, such as sulphuric acid or p-toluenesulfonic acid, to promote the formation of the ester bond. The reaction mixture is refluxed to ensure complete conversion, and water formed during esterification is removed to drive the reaction forward. After completion, the product is purified through distillation or solvent extraction, yielding di-n-propyl isocinchomeronate. | [Pesticide Type]
Insecticide; Repellent; Veterinary substance |
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Telephone: |
18210857532 18210857532 |
| Website: |
https://www.jkchemical.com |
|