| Identification | Back Directory | [Name]
2,2'-METHYLENEBIS[(4R,5S)-4,5-DIPHENYL-2-OXAZOLINE] | [CAS]
139021-82-2 | [Synonyms]
(R,S)-BisPh-mebBox 2,2-methylenebis((4R,5S)-4,5-diphenyl-2-oxazolin 2,2'-METHYLENEBIS[(4R,5S)-4,5-DIPHENYL-2-OXAZOLINE] Bis((4R,5S)-4,5-diphenyl-4,5-dihydrooxazol-2-yl)methane (4R,5S,4'R,5'S)-2,2'-METHYLENEBIS(4,5-DIPHENYL-2-OXAZOLINE) (4R,4'R,5S,5'S)-2,2'-methylenebis[4,5-dihydro-4,5-diphenyl-Oxazole Oxazole, 2,2'-methylenebis[4,5-dihydro-4,5-diphenyl-, (4R,4'R,5S,5'S)- (4S,5R,4'S,5'R)-2,2'-Methylenebis(4,5-diphenyl-4,5-dihydro-1,3-oxazole) | [Molecular Formula]
C31H26N2O2 | [MDL Number]
MFCD00192294 | [MOL File]
139021-82-2.mol | [Molecular Weight]
458.55 |
| Chemical Properties | Back Directory | [Melting point ]
205-208 °C | [Boiling point ]
597.3±50.0 °C(Predicted) | [density ]
1.19±0.1 g/cm3(Predicted) | [storage temp. ]
under inert gas (nitrogen or Argon) at 2–8 °C | [pka]
4.03±0.70(Predicted) | [Appearance]
White to off-white Solid | [InChIKey]
BVEHHQYXICTXGR-VKONIRKNSA-N | [SMILES]
C(C1=N[C@H](C2=CC=CC=C2)[C@H](C2=CC=CC=C2)O1)C1=N[C@H](C2=CC=CC=C2)[C@H](C2=CC=CC=C2)O1 |
| Hazard Information | Back Directory | [Uses]
C2 symmetric ligand for enantioselective catalysis. Easily forms bidentate coordination complexes due to the strong affinity of the oxazoline nitrogen for various metals. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|