| Identification | Back Directory | [Name]
N,N′-Bis-(4-thiazol-2-yl-benzyl)-ethane-1,2-diamine | [CAS]
1507370-40-2 | [Synonyms]
BC-1258 N,N′-Bis-(4-thiazol-2-yl-benzyl)-ethane-1,2-diamine 1,2-Ethanediamine, N1,N2-bis[[4-(2-thiazolyl)phenyl]methyl]- N,N'-bis[[4-(1,3-thiazol-2-yl)phenyl]methyl]ethane-1,2-diamine LRR,F-box,inhibit,repeat,BC-?1258,BC ?1258,FBXL2,Apoptosis,tumor,Inhibitor,BC?1258 | [Molecular Formula]
C22H22N4S2 | [MDL Number]
MFCD28137686 | [MOL File]
1507370-40-2.mol | [Molecular Weight]
406.57 |
| Chemical Properties | Back Directory | [storage temp. ]
2-8°C | [solubility ]
DMSO: soluble10mg/mL, clear (warmed) | [form ]
powder | [color ]
white to beige | [InChI]
InChI=1S/C22H22N4S2/c1-5-19(21-25-11-13-27-21)6-2-17(1)15-23-9-10-24-16-18-3-7-20(8-4-18)22-26-12-14-28-22/h1-8,11-14,23-24H,9-10,15-16H2 | [InChIKey]
FRTSLZJCGAFSET-UHFFFAOYSA-N | [SMILES]
C(NCC1=CC=C(C2=NC=CS2)C=C1)CNCC1=CC=C(C2=NC=CS2)C=C1 |
| Hazard Information | Back Directory | [Description]
BC-1258 (N,N′-Bis-(4-thiazol-2-yl-benzyl)-ethane-1,2-diamine) is a potent activator of unique E3 ligase F-box/LRR-repeat protein 2 (FBXL2) that increases levels of FBXLs protein, thus promoting Aurora B degradation. BC-1258 induces mitotic arrest and apoptosis of tumorigenic cells. Also BC-1258 inhibits tumor formation in athymic nude mice. | [Uses]
BC-1258,an F-box/LRR-repeat protein 2 (FBXL2) activator,can stabilize and upregulate FBXL2 levels. BC-1258 induces apoptosis of tumorigenic cells,and profoundly inhibits tumor formation in mice[1]. | [Mechanism of action]
BC-1258 is a unique small molecule F-box/LRR-repeat protein 2 (FBXL2) activator that stabilized and increased levels of FBXL2 protein that promoted Aurora B degradation, resulting in tetraploidy, mitotic arrest and apoptosis of tumorigenic cells, and profoundly inhibiting tumor formation in athymic nude mice. It is sufficient to stabilize and upregulate FBXL2 levels, and, when administered in vivo, prematurely depletes Aurora B by SCFFBXL2-induced ubiquitination and degradation, leading to cell death and inhibiting growth of human leukemic cells in a xenograft model[1].
| [in vivo]
BC-1258 (30 μg/mL in the drinking water) significantly reduces tumor size and weight in athymic nude mice[1]. | [References]
[1] B B Chen. “Skp-cullin-F box E3 ligase component FBXL2 ubiquitinates Aurora B to inhibit tumorigenesis.” Cell Death & Disease (2013): e759. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Website: |
https://www.bocsci.com |
| Company Name: |
Lynnchem
|
| Tel: |
86-(0)29-85992781 17792393971 |
| Website: |
http://www.lynnchem.com/ |
| Company Name: |
Novachemistry
|
| Tel: |
44-20819178-90 02081917890 |
| Website: |
https://www.novachemistry.com/ |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
cjbscvictory
|
| Tel: |
13348960310 |
| Website: |
https://www.weikeqi-biotech.com/ |
|