| Identification | Back Directory | [Name]
[(difluoromethyl)thio]benzene | [CAS]
1535-67-7 | [Synonyms]
[(difluoromethyl)thio]benzene Phenyl difluoromethyl sulfide Difluoromethyl Phenyl Sulfide (difluoromethyl)(phenyl)sulfane alpha,alpha-Difluorothioanisole Benzene, [(difluoroMethyl)thio]- [(difluoromethyl)sulfanyl]benzene | [EINECS(EC#)]
216-255-8 | [Molecular Formula]
C7H6F2S | [MDL Number]
MFCD16301013 | [MOL File]
1535-67-7.mol | [Molecular Weight]
160.184 |
| Chemical Properties | Back Directory | [Boiling point ]
63°C/7mmHg(lit.) | [density ]
1.21±0.1 g/cm3(Predicted) | [refractive index ]
1.5090 to 1.5130 | [form ]
clear liquid | [color ]
Colorless to Almost colorless | [InChI]
InChI=1S/C7H6F2S/c8-7(9)10-6-4-2-1-3-5-6/h1-5,7H | [InChIKey]
KDNBCPHMQJEQLV-UHFFFAOYSA-N | [SMILES]
C1(SC(F)F)=CC=CC=C1 |
|
| Company Name: |
Henan Alpha Chemical Co., Ltd.
|
| Telephone: |
0371-55055611 18137792234 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList31206/0.htm |
| Company Name: |
Labnetwork lnc.
|
| Telephone: |
+86-27-50766799 +86-18062016861 |
| Website: |
www.labnetwork.com |
|