| Identification | Back Directory | [Name]
α-(4’-Hydroxyphenyl)phloroacetophenone | [CAS]
15485-65-1 | [Synonyms]
15485-65-1 2-(p-Hydroxyphenyl)phloroacetophenone α-(4’-Hydroxyphenyl)phloroacetophenone α-(4’-Hydroxyphenyl)phloroacetophenone α-(4'-Hydroxyphenyl)phloroacetophenone,98% 2,4,6-Trihydroxyphenyl-4'-hydroxybenzyl Ketone 2-(4-Hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)ethanone Ethanone, 2-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)- | [EINECS(EC#)]
239-169-2 | [Molecular Formula]
C14H12O5 | [MOL File]
15485-65-1.mol | [Molecular Weight]
260.24 |
| Chemical Properties | Back Directory | [Melting point ]
240-245°C (dec.) | [Boiling point ]
509.4±19.0 °C(Predicted) | [density ]
1.483±0.06 g/cm3 (20 ºC 760 Torr) | [storage temp. ]
Refrigerator | [solubility ]
Acetone, DMSO (Slightly), Methanol (Slightly) | [form ]
Solid | [pka]
7.06±0.40(Predicted) | [color ]
Pale Beige to Beige | [InChI]
InChI=1S/C14H12O5/c15-9-3-1-8(2-4-9)5-11(17)14-12(18)6-10(16)7-13(14)19/h1-4,6-7,15-16,18-19H,5H2 | [InChIKey]
XYMPPRJBUSAOQA-UHFFFAOYSA-N | [SMILES]
C(=O)(C1=C(O)C=C(O)C=C1O)CC1=CC=C(O)C=C1 |
| Hazard Information | Back Directory | [Chemical Properties]
Tan Solid | [Uses]
Genistein intermediate. | [Uses]
α-(4’-Hydroxyphenyl)phloroacetophenone is a Genistein intermediate. | [Preparation]
Preparation by reaction of p-hydroxyphenyl-acetonitrile with phloroglucinol (Hoesch reaction) (58%). |
|
| Company Name: |
Lynnchem
|
| Tel: |
86-(0)29-85992781 17792393971 |
| Website: |
http://www.lynnchem.com/ |
| Company Name: |
Novachemistry
|
| Tel: |
44-20819178-90 02081917890 |
| Website: |
https://www.novachemistry.com/ |
|