| Identification | Back Directory | [Name]
CIS-STILBENE OXIDE | [CAS]
1689-71-0 | [Synonyms]
Nsc133513 CIS-STILBENE OXIDE meso-Stilbene oxide cis-Stilbene oxide 97% cis-2,3-diphenyloxirane Oxirane,cis-2,3-diphenyl- (2R,3S)-2,3-Diphenyloxirane (2S,3R)-2,3-Diphenyloxirane Oxirane, 2,3-diphenyl-, cis- Bibenzyl, .alpha.,.alpha.'-epoxy-, cis- cis-Stilbene oxide,cis-2,3-Diphenyloxirane | [Molecular Formula]
C14H12O | [MDL Number]
MFCD00005122 | [MOL File]
1689-71-0.mol | [Molecular Weight]
196.24 |
| Chemical Properties | Back Directory | [Appearance]
solid | [Melting point ]
38-40 °C(lit.)
| [Boiling point ]
126-132 °C(Press: 4 Torr) | [density ]
1.136±0.06 g/cm3(Predicted) | [Fp ]
>230 °F
| [storage temp. ]
2-8°C | [Stability:]
Stable, but may be air sensitive-store under nitrogen. Incompatible with acids, bases, oxidizing agents. | [BRN ]
82737 | [InChI]
1S/C14H12O/c1-3-7-11(8-4-1)13-14(15-13)12-9-5-2-6-10-12/h1-10,13-14H/t13-,14+ | [InChIKey]
ARCJQKUWGAZPFX-OKILXGFUSA-N | [SMILES]
O1[C@H]([C@H]1c2ccccc2)c3ccccc3 |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Hubei Baidu Chemical Co., Ltd
|
| Tel: |
027-027-59106051 13627137652 |
| Website: |
www.chemicalbook.com/showsupplierproductslist329110/0_en.htm |
|