| Identification | Back Directory | [Name]
P-TERPHENYL-D14 | [CAS]
1718-51-0 | [Synonyms]
Terphenyl-d14 4-Terphenyl-d14 [2H14]Terphenyl P-TERPHENYL-D14 p-terphenyl-d14 solution 1,1':4',1''-Terphenyl-d14 P-TERPHENYL-D14, 100MG, NEAT P-TERPHENYL-D14, 98 ATOM % D p-Terphenyl-d14 50mg [1718-51-0] p-Terphenyl-d14 Solution, 2000μg/mL 4-TERPHENYL-D14, 1X1ML, CH2CL2, 2000UG/M L 1,2,4,5-tetradeuterio-3,6-bis(2,3,4,5,6-pentadeuteriophenyl)benzene 1,2,3,4,5-pentadeuterio-6-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzene P-Terphenyl-d14Q: What is
P-Terphenyl-d14 Q: What is the CAS Number of
P-Terphenyl-d14 Q: What is the storage condition of
P-Terphenyl-d14 Q: What are the applications of
P-Terphenyl-d14 | [EINECS(EC#)]
625-035-4 | [Molecular Formula]
C18H14 | [MDL Number]
MFCD00084184 | [MOL File]
1718-51-0.mol | [Molecular Weight]
230.31 |
| Chemical Properties | Back Directory | [Melting point ]
212-213 °C(lit.) | [storage temp. ]
0-6°C | [solubility ]
Chloroform (Sparingly), DMSO (Sparingly) | [form ]
neat | [InChI]
InChI=1S/C18H14/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16/h1-14H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D | [InChIKey]
XJKSTNDFUHDPQJ-WZAAGXFHSA-N | [SMILES]
C1(C2C([2H])=C([2H])C([2H])=C([2H])C=2[2H])C([2H])=C([2H])C(C2C([2H])=C([2H])C([2H])=C([2H])C=2[2H])=C([2H])C=1[2H] | [EPA Substance Registry System]
1,1':4',1''-Terphenyl-2,2',2'',3,3',3'',4,4'',5,5',5'',6,6',6''-d14 (1718-51-0) | [CAS Number Unlabeled]
92-94-4 |
|
| Company Name: |
Energy Chemical Gold
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
China Langchem Inc.
|
| Tel: |
021-58956006,021-58950017 15800617331 |
| Website: |
http://www.isotopemall.com/ |
| Company Name: |
Spectrum Chemical Manufacturing Corp.
|
| Tel: |
021-021-021-67601398-809-809-809 15221380277 |
| Website: |
www.spectrumchemical.com/oa_html/index.jsp?minisite=10020&respid=22372&language=us |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Rhawn Reagent
|
| Tel: |
400-400-1332688 18019345275 |
| Website: |
http://www.rhawn.cn |
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Tel: |
0371-55051623 18137891487 |
| Website: |
https://www.chemicalbook.com/supplier/14555231/ |
|