| Identification | More | [Name]
4-Chloro-3,5-difluorobromobenzene | [CAS]
176673-72-6 | [Synonyms]
1-BROMO-4-CHLORO-3,5-DIFLUOROBENZENE
5-BROMO-2-CHLORO-1,3-DIFLUOROBENZENE
5-Bromo-2-chloro-1,3-difluorobenzene 97%
5-Bromo-2-chloro-1,3-difluorobenzene97% | [Molecular Formula]
C6H2BrClF2 | [MDL Number]
MFCD00143420 | [Molecular Weight]
227.43 | [MOL File]
176673-72-6.mol |
| Chemical Properties | Back Directory | [Boiling point ]
190.5±35.0 °C(Predicted) | [density ]
1.805±0.06 g/cm3(Predicted) | [storage temp. ]
Sealed in dry,Room Temperature | [form ]
liquid | [color ]
Clear, faint yellow | [InChI]
InChI=1S/C6H2BrClF2/c7-3-1-4(9)6(8)5(10)2-3/h1-2H | [InChIKey]
SWELJVAWQMCJLG-UHFFFAOYSA-N | [SMILES]
C1(F)=CC(Br)=CC(F)=C1Cl | [CAS DataBase Reference]
176673-72-6(CAS DataBase Reference) |
| Hazard Information | Back Directory | [Chemical Properties]
Colorless to pale yellow liquid | [Uses]
4-Chloro-3,5-difluorobromobenzene has various uses in chemical synthesis, especially as a synthetic intermediate in the fields of medicine and pesticide chemistry, and can be used to synthesize complex molecules with specific biological activities, such as drug molecules, hormones or bioactive molecules. |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
|