| Identification | Back Directory | [Name]
Indolo[3,2,1-jk]carbazole | [CAS]
205-95-8 | [Synonyms]
Indolo[3,2,1-jk]carbazole | [EINECS(EC#)]
200-258-5 | [Molecular Formula]
C18H11N | [MDL Number]
MFCD01851757 | [MOL File]
205-95-8.mol | [Molecular Weight]
241.29 |
| Chemical Properties | Back Directory | [Melting point ]
134.0 to 138.0 °C | [Boiling point ]
392.1±15.0 °C(Predicted) | [density ]
1.26±0.1 g/cm3(Predicted) | [storage temp. ]
Sealed in dry,Room Temperature | [form ]
powder to crystal | [color ]
White to Light yellow | [λmax]
300nm(EtOH)(lit.) | [InChI]
InChI=1S/C18H11N/c1-3-10-16-12(6-1)14-8-5-9-15-13-7-2-4-11-17(13)19(16)18(14)15/h1-11H | [InChIKey]
SZLNOBJKCVERBJ-UHFFFAOYSA-N | [SMILES]
N12C3=C(C4C1=C(C=CC=4)C1=C2C=CC=C1)C=CC=C3 |
|
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Telephone: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
| Company Name: |
TCI Chemicals
|
| Telephone: |
021-67121386, 800-988-0390 |
| Website: |
www.tcichemicals.com |
|