| Identification | Back Directory | [Name]
DIETHYL(4-BROMOPHENYL)PHOSPHONATE | [CAS]
20677-12-7 | [Synonyms]
Diethyl 4-bromobenzenephosphonate Diethyl p-bromobenzenephosphonate DIETHYL(4-BROMOPHENYL)PHOSPHONATE Diethyl (p-bromophenyl)phosphonate 1-Bromo-4-diethoxyphosphorylbenzene Diethyl (4-Bromobenzene)sphosphonate Diethyl(4-bromophenyl)phosphonate, 98 % (4-Bromophenyl)phosphonic Acid Diethyl Ester P-(4-Bromophenyl)phosphonic acid diethyl ester Phosphonic acid,P-(4-bromophenyl)-, diethyl ester | [Molecular Formula]
C10H14BrO3P | [MDL Number]
MFCD00769296 | [MOL File]
20677-12-7.mol | [Molecular Weight]
293.09 |
| Chemical Properties | Back Directory | [Melting point ]
73-75℃ | [Boiling point ]
120°C/0.4mmHg(lit.) | [density ]
1.41 | [refractive index ]
1.5240 to 1.5280 | [form ]
clear liquid | [color ]
Colorless to Light yellow |
|
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
|