| Identification | Back Directory | [Name]
TRANS-1-DECALONE | [CAS]
21370-71-8 | [Synonyms]
trans-Decalone trans-Decalone-1 TRANS-1-DECALONE 1-Decalone, trans- trans-alpha-Decalone trans-1-Decalone,98% trans-1-Decalone 98% (4aS,8aR)-Decalin-1-one (4aα,8aα)-Decalin-1-one Octahydro-1(2H)-naphthalenone Octahydro-2H-naphthalen-1-one TRANS-DECAHYDRO-1-NAPHTHALENONE trans-bicyclo(4.4.0)decan-1-one trans-Bicyclo[4.4.0]decan-2-one (1R,6S)-Bicyclo[4.4.0]decan-2-one (1R,6R)-Bicyclo[4.4.0]decan-2-one (1S,6R)-Bicyclo[4.4.0]decan-2-one (4aR,8aS)-Decahydronaphthalene-1-one (4aα,8aβ)-Decahydronaphthalene-1-one (4aS)-3,4,4aβ,5,6,7,8,8aα-Octahydronaphthalene-1(2H)-one (4aα,8aβ)-3,4,4a,5,6,7,8,8a-Octahydronaphthalen-1(2H)-one | [EINECS(EC#)]
244-352-5 | [Molecular Formula]
C10H16O | [MDL Number]
MFCD00064175 | [MOL File]
21370-71-8.mol | [Molecular Weight]
152.23 |
| Chemical Properties | Back Directory | [Appearance]
White to faintly yellow low melting solid | [Melting point ]
30-32 °C(lit.)
| [Boiling point ]
73 °C1 mm Hg(lit.)
| [density ]
0.9860 | [refractive index ]
1.4849 (estimate) | [Fp ]
196 °F
| [InChI]
1S/C10H16O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h8-9H,1-7H2/t8-,9+/m1/s1 | [InChIKey]
AFEFRXAPJRCTOW-BDAKNGLRSA-N | [SMILES]
[H][C@]12CCCC[C@]1([H])C(=O)CCC2 |
| Hazard Information | Back Directory | [Chemical Properties]
White to faintly yellow low melting solid | [Uses]
The product has been used to study its proton resonance spectra using NMR. | [Uses]
trans-1-Decalone is a chemical compound that has antimicrobial and antioxidant activity of essential oils isolated from Citrus aurantium. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Acros Organics
|
| Tel: |
+32 14/57.52.11 |
| Website: |
www.acros.be |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|