| Identification | Back Directory | [Name]
Dibenzofuran, 1-bromo-7-chloro- | [CAS]
2173555-52-5 | [Synonyms]
1-bromo-7-chlorodibenzofuran
Dibenzofuran, 1-bromo-7-chloro-
1-bromo-7-chlorodibenzo[b,d]furan
Dibenzofuran, 1-bromo-7-chloro- ISO 9001：2015 REACH | [Molecular Formula]
C12H6BrClO | [MDL Number]
MFCD32669963 | [MOL File]
2173555-52-5.mol | [Molecular Weight]
281.53 |
| Chemical Properties | Back Directory | [Boiling point ]
376.4±22.0 °C(Predicted) | [density ]
1.669±0.06 g/cm3(Predicted) | [InChI]
InChI=1S/C12H6BrClO/c13-9-2-1-3-10-12(9)8-5-4-7(14)6-11(8)15-10/h1-6H | [InChIKey]
WXKGFVXGRJHAML-UHFFFAOYSA-N | [SMILES]
O1C2=CC(Cl)=CC=C2C2=C(Br)C=CC=C12 |
| Hazard Information | Back Directory | [Synthesis]
2'-bromo-4-chloro-6'-fluoro-[1,1'-biphenyl]-2-ol (33.25 g, 110.27 mmol), Cs2CO3(71.86 g, 220.54 mmol), and a mixture of dimethylacetamide (330ml) was stirred at 150°C.After cooling, the filtrate was filtered, and the solvent of the filtrate was filtered through silica gel to obtain 1-Bromo-7-chlorodibenzo[b,d]furan. (24.84g, 80%).
|
|
| Company Name: |
Sholon Chem-Tech Co.,Ltd Gold
|
| Telephone: |
+86-19901505185 +86-15312550623 |
| Website: |
https://www.trusyn.com.cn |
| Company Name: |
Sunshine Optoelectronic
|
| Telephone: |
027-027-87915283 15972929998 |
| Website: |
http://www.sunshine-oled.com |
| Company Name: |
Baynoe Chem Co.,LTD
|
| Telephone: |
+86-021-34783353 15000719740 |
| Website: |
http://www.baynoe.com |
| Company Name: |
Henan Alpha Chemical Co., Ltd.
|
| Telephone: |
0371-55055611 18137792234 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList31206/0.htm |
|