| Identification | Back Directory | [Name]
5-METHOXY-1-INDANONE-3-ACETIC ACID | [CAS]
24467-92-3 | [Synonyms]
5-METHOXY-1-INDANONE-3-ACETIC ACID 6-METHOXY-3-OXO-1-INDANACETIC ACID 5-Methoxy-1-oxoindane-3-acetic acid 5-methoxy-4-oxoindan-3-ylacetic acid 5-METHOXY-1-INDANONE-3-ACETIC ACID, TECH . 2,3-dihydro-6-methoxy-3-oxo-1h-indene-1-aceticaci 6-methoxy-3-oxo-2,3-dihydro-1h-indene-1-aceticacid 2,3-Dihydro-6-methoxy-3-oxo-1H-indene-1-acetic acid 1H-Indene-1-acetic acid, 2,3-dihydro-6-methoxy-3-oxo- 2-(6-Methoxy-3-oxo-2,3-dihydro-1H-inden-1-yl)acetic acid | [Molecular Formula]
C12H12O4 | [MDL Number]
MFCD00003787 | [MOL File]
24467-92-3.mol | [Molecular Weight]
220.22 |
| Chemical Properties | Back Directory | [Melting point ]
139-144 °C (lit.) | [Boiling point ]
429℃ | [density ]
1.286 | [Fp ]
171℃ | [solubility ]
chloroform: soluble5%, clear, yellow-brown | [form ]
powder | [InChI]
1S/C12H12O4/c1-16-8-2-3-9-10(6-8)7(4-11(9)13)5-12(14)15/h2-3,6-7H,4-5H2,1H3,(H,14,15) | [InChIKey]
QOTZOFGBBCMWEP-UHFFFAOYSA-N | [SMILES]
COc1ccc2C(=O)CC(CC(O)=O)c2c1 |
| Hazard Information | Back Directory | [Uses]
The 5-methoxy-1-indanone-3-acetic acid derivatives are potent inhibitors of chymotrypsin-like activity of the 20S proteasome. | [General Description]
The 5-methoxy-1-indanone-3-acetic acid derivatives are potent inhibitors of chymotrypsin-like activity of the 20S proteasome. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
A.J Chemicals
|
| Tel: |
91-9810153283 |
| Website: |
www.ajchemicals.com |
|