| Identification | Back Directory | [Name]
2,4/2,6-Diaminotoluene | [CAS]
25376-45-8 | [Synonyms]
NA-1709 200KGS/DRUM m-Diaminotoluene Diaminotoluene (DAT) Methylphenylenediamine ar-Methylbenzenediamine Benzenediamine, ar-methyl- ar-Methyl-1,3-benzenediamine 1,3-Benzenediamine, ar-methyl- | [EINECS(EC#)]
246-910-3 | [Molecular Formula]
2C7H10N2 | [MDL Number]
MFCD00071739 | [MOL File]
25376-45-8.mol | [Molecular Weight]
244.34 |
| Chemical Properties | Back Directory | [Boiling point ]
217.6°C (rough estimate) | [density ]
1.0343 (rough estimate) | [refractive index ]
1.5040 (estimate) | [InChI]
InChI=1S/2C7H10N2/c1-5-2-3-6(8)4-7(5)9;1-5-6(8)3-2-4-7(5)9/h2*2-4H,8-9H2,1H3 | [InChIKey]
GWXQNFKETHVQIZ-UHFFFAOYSA-N | [SMILES]
C1(C)C(N)=CC=CC=1N.C1(N)=CC(=CC=C1C)N | [CAS DataBase Reference]
25376-45-8 | [EPA Substance Registry System]
Toluenediamine (25376-45-8) |
| Hazard Information | Back Directory | [Uses]
2,4/2,6-Diaminotoluene: 1. Primarily used as a raw material for the synthesis of TDI and as a polyether initiator. Polyether polyols synthesized using TDA as an initiator produce uniform and fine foams, which can improve the thermal insulation performance and low-temperature dimensional properties of the foam. 2. It can be used as an epoxy resin curing agent and dye intermediate. 3. Synthesized as aromatic diamine curing agents for polyurethane elastomers and epoxy resins: dimethylthiotoluenediamine (DMTDA) and diethyltoluenediamine (DETDA). |
|
| Company Name: |
SIMAGCHEM CORP
|
| Telephone: |
+86-5922680277 +86-13806087780 |
| Website: |
http://www.simagchem.com/ |
|