| Identification | Back Directory | [Name]
Cobalt tetramethoxyphenylporphyrin | [CAS]
28903-71-1 | [Synonyms]
TMPPCO TMOPP-CO MOLYBDATE IONOPHORE I Arsenite Ionophore I
Cobalt (II) meso-tetramethoxyphe COBALT TETRAMETHOXYPHENYLPORPHYRIN TETRAMETHOXYPHENYLPORPHYRIN COBALT II Cobalt tetramethoxyphenylporphyrin,94% Cobalt tetraMethoxyphenylporphyrin, 94% 1GR COBALT (II) MESO-TETRAMETHOXYPHENYLPORPHINE Tetra(4-methoxyphenyl)porphine cobalt complex TETRA(4-METHOXYPHENYL)PORPHYRIN COBALT COMPLEX Cobalt(II) meso-tetra(4-methoxyphenyl)porphine Tetra(4-methoxyphenyl)porphyrine cobalt complex Cobalt(II) meso-tetrakis(4-methoxyphenyl)porphine TETRAKIS(4-METHOXYPHENYL)-21H,23H-PORPHINE COBALT(II) Cobalt(II) Meso-tetra(4-Methoxyphenyl)porphine, Min. 96% Co(II) meso-Tetra (4-methoxyphenyl) Porphine (1-3% chlorin) [5,10,15,20-Tetrakis(4-methoxyphenyl)porphyrinato]cobalt(II) 5,10,15,10-Tetrakis-(4-methoxyphenyl)-21H,23H-porphine cobalt 5,10,15,20-TETRAKIS(4-METHOXYPHENYL)-21H,23H-PORPHINE COBALT(II) 5,10,15,20-TETRAKIS(4-METHOXYPHENYL)PORPHYRINE COBALT(II) COMPLEX 5,10,15,20-TETRAKIS(4-METHOXYPHENYL)-21H,23H-PORPHYRINE COBALT(II) [5,10,15,20-TETRAKIS(4-METHOXYPHENYL)-21H,23H-PORPHINATO]COBALT(II) 5,10,15,20-TETRAKIS(4-METHOXYPHENYL)-21H ,23H-PORPHINE COBALT(II), SYNTHETIC TMOPP-Co, 5,10,15,20-Tetrakis(4-methoxyphenyl)porphyrine cobalt(II) Complex 5,10,15,20-Tetrakis(4-Methoxyphenyl)-21H,23H-porphine cobalt(II) >=96.0% (HPLC) Cobalt, [5,10,15,20-tetrakis(4-methoxyphenyl)-21H,23H-porphinato(2-)-κN21,κN22,κN23,κN24]-, (SP-4-1)- 2,4,5,20-tetraMethoxy-19-phenyl-21,22,23,24-tetraazapentacyclo[16.2.1.1^{3,6}.1^{8,11}.1^{13,16}]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene cobalt | [EINECS(EC#)]
-0 | [Molecular Formula]
C48H36CoN4O4 | [MDL Number]
MFCD00010724 | [MOL File]
28903-71-1.mol | [Molecular Weight]
791.76 |
| Chemical Properties | Back Directory | [Appearance]
PURPLE POWDER | [Melting point ]
241-248°C | [storage temp. ]
Sealed in dry,Room Temperature | [form ]
Crystals or Powder | [color ]
Purple to violet | [λmax]
417 nm 530 nm (2nd) | [InChIKey]
QBCIMRXPMLWVML-NHZJRHMYSA-N | [SMILES]
O(C1C=CC(C2=C3C=CC4C(C5C=CC(OC)=CC=5)=C5C=CC6=C(C7C=CC(OC)=CC=7)C7C=CC8=C(C9C=CC(OC)=CC=9)C9=CC=C2[N-]9[Co+2](N=78)([N-]56)N3=4)=CC=1)C |
| Hazard Information | Back Directory | [Chemical Properties]
PURPLE POWDER | [Description]
[5,10,15,20-Tetrakis(4-methoxyphenyl)porphyrinato]cobalt(II) is a versatile metalloporphyrin compound with significant potential in various applications. It is widely used in photodynamic therapy (PDT) for cancer treatment, where it can absorb light and produce reactive oxygen species to target and destroy cancer cells. Additionally, it plays a crucial role in the development of solar cells, enhancing the efficiency of light absorption and energy conversion in photovoltaic devices. The compound also serves as a catalyst in various chemical reactions, particularly in organic synthesis, improving reaction rates and selectivity compared to traditional catalysts. Furthermore, it is employed in the creation of sensors for detecting environmental pollutants, leveraging its ability to interact with specific molecules for accurate measurements. Its unique porphyrin structure makes it valuable in academic research for studying the properties of metal-organic frameworks and their potential applications in drug delivery and materials science. | [Uses]
Tetrakis(4-methoxyphenyl)-21H,23H-porphine cobalt(II) is an organometallic complex used as an oxidation catalyst in a variety of synthetic reactions such as the selective oxidation of amines. | [General Description]
Arsenite Ionophore I (5,10,15,20-tetrakis(4-methoxyphenyl)porphyrinatocobalt (TMOPP-Co)) can be synthesized by boiling a mixture of 5,10,15,20-tetrakis (4-methoxyphenyl)porphyrin (TMOPP) and cobalt acetate in glacial acetic acid. It has tendency towards attracting molybdate ions. | [reaction suitability]
reagent type: catalyst core: cobalt |
|
|