| Identification | Back Directory | [Name]
3-phenylnaphthalen-1-ol | [CAS]
30069-65-9 | [Synonyms]
3-phenylnaphthalen-1-ol 3-phenylnaphthlaene-1-ol 1-Naphthalenol, 3-phenyl- | [Molecular Formula]
C16H12O | [MDL Number]
MFCD00474644 | [MOL File]
30069-65-9.mol | [Molecular Weight]
220.27 |
| Chemical Properties | Back Directory | [Melting point ]
96-97.5 °C(Solv: chloroform (67-66-3); hexane (110-54-3)) | [Boiling point ]
417.4±24.0 °C(Predicted) | [density ]
1.176±0.06 g/cm3(Predicted) | [pka]
9.28±0.40(Predicted) | [InChI]
InChI=1S/C16H12O/c17-16-11-14(12-6-2-1-3-7-12)10-13-8-4-5-9-15(13)16/h1-11,17H | [InChIKey]
MAPYOCUYNJWAJW-UHFFFAOYSA-N | [SMILES]
C1(O)=C2C(C=CC=C2)=CC(C2=CC=CC=C2)=C1 |
| Hazard Information | Back Directory | [Uses]
3-phenylnaphthalen-1-ol is used as chemical reagents, fine chemicals and the intermediates of electronic chemical materials.
|
|
|