| Identification | Back Directory | [Name]
Flupentixol decanoate | [CAS]
30909-51-4 | [Synonyms]
FLUPENTIXOL DECANOATE Flupenthixol decanote Flupentixol decanoate USP/EP/BP 2-[4-[3-[2-(trifluoromethyl)-9H-thioxanthen-9-ylidene]propyl]-1-piperazinyl]ethyl decanoate 1-DECANOLOXY-2-(4-[3-(S-TRIFLUOROMETHYL-THIOXANTHEN-9-YLIDENE)-PROPYL]-PIPERZAIN-1-YL]-ETHANE 1-DECANOLOXY-2-(4-[3-(2-TRIFLUOROMETHYL-THIOXANTHEN-9-YLIDENE)-PROPYL]-PIPERAZIN-1-YL)-ETHANE (E)-2-(4-(3-(2-(trifluoroMethyl)-9H-thioxanthen-9-ylidene)propyl)piperazin-1-yl)ethyl decanoate Decanoic acid 2-[4-[3-[2-(trifluoromethyl)-9H-thioxanthen-9-ylidene]propyl]-1-piperazinyl]ethyl ester Flupentixol DecanoateQ: What is
Flupentixol Decanoate Q: What is the CAS Number of
Flupentixol Decanoate Q: What is the storage condition of
Flupentixol Decanoate Q: What are the applications of
Flupentixol Decanoate | [EINECS(EC#)]
250-385-6 | [Molecular Formula]
C33H43F3N2O2S | [MDL Number]
MFCD03792796 | [MOL File]
30909-51-4.mol | [Molecular Weight]
588.77 |
| Chemical Properties | Back Directory | [Boiling point ]
648.0±55.0 °C(Predicted) | [density ]
1.169±0.06 g/cm3(Predicted) | [storage temp. ]
-20°C | [form ]
oil | [pka]
7.20±0.10(Predicted) | [Major Application]
pharmaceutical pharmaceutical small molecule | [InChIKey]
UIKWDDSLMBHIFT-UVHMKAGCSA-N | [SMILES]
FC(F)(F)c1cc2c(cc1)Sc3c(cccc3)\C\2=C/CCN4CCN(CC4)CCOC(=O)CCCCCCCCC | [Uses]
Dopamine receptor antagonist; neuroleptic. |
|
| Company Name: |
Ralington Pharma
|
| Tel: |
+91-7948911722 +91-9687771722 |
| Website: |
www.ralingtonpharma.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|