| Identification | Back Directory | [Name]
BIS(MU-DIMETHYLAMINO)TETRAKIS(DIMETHYLAMINO)DIALUMINUM | [CAS]
32093-39-3 | [Synonyms]
Bis(µ TRIS(DIMETHYLAMINO)ALANE Tris(dimethylamino)alane,dimer tris(dimethylamido)aluminum(iii) Hexakis(dimethylamino)dialuminum Tris(dimethylamino)aluminum (III) Tris(dimethylamino)alumunum(III) 98% Tris(diMethylaMino)aluMinuM diMer, 99% -dimethylamino)tetrakis(dimethylamino)dialuminum BIS(-DIMETHYLAMINO)TETRAKIS(DIMETHYLAMINO)DIALUMINUM Bis((dimethylamino)tetrakis(dimethylamino)dialuminium BIS(MU-DIMETHYLAMINO)TETRAKIS(DIMETHYLAMINO)DIALUMINUM Bis-(u-dimethylamino)-tetrakis-(dimethylamino)-dialuminum | [Molecular Formula]
C12H36Al2N6 | [MDL Number]
MFCD00269811 | [MOL File]
32093-39-3.mol | [Molecular Weight]
318.42 |
| Chemical Properties | Back Directory | [Melting point ]
82-84 °C(lit.)
| [Boiling point ]
90℃/0.05mm subl. | [density ]
0.865 g/mL at 25 °C(lit.)
| [Fp ]
70 °F
| [form ]
Powder | [color ]
white to yellow | [Sensitive ]
Moisture Sensitive | [InChI]
1S/6C2H6N.2Al/c6*1-3-2;;/h6*1-2H3;;/q6*-1;2*+3 | [InChIKey]
JGZUJELGSMSOID-UHFFFAOYSA-N | [SMILES]
CN(C)[Al](N(C)C)N(C)C.CN(C)[Al](N(C)C)N(C)C |
| Safety Data | Back Directory | [Hazard Codes ]
F,C | [Risk Statements ]
11-14/15-34 | [Safety Statements ]
16-26-36/37/39-43 | [RIDADR ]
UN 3131 4.3/PG 1
| [WGK Germany ]
3
| [HazardClass ]
4.3 | [Storage Class]
4.3 - Hazardous materials which set free flammable gases upon contact with water | [Hazard Classifications]
Skin Corr. 1B Water-react 1 |
|
| Company Name: |
Alfa Aesar
|
| Telephone: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Domole Scientific
|
| Telephone: |
13275595566; 13275595566 |
| Website: |
http://www.domole.com/ |
| Company Name: |
3A Chemicals
|
| Telephone: |
400-668-9898 |
| Website: |
www.3achem.com |
|