| Identification | Back Directory | [Name]
MANGANESE STEARATE | [CAS]
3353-05-7 | [Synonyms]
MANGANESE STEARATE manganese distearate MANGANESE(II) STEARATE Manganese octadecanoate Manganese (Ⅱ) Stearate manganesedistearate,pure Manganese(2+) dioctadecanoate Octadecanoic acid,manganesesalt octadecanoic acid, manganese salt Distearic acid manganese(II) salt Bisstearic acid manganese(II) salt Octadecanoicacid,manganese(2+)salt octadecanoicacid,manganese(2++)salt Bis(stearic acid) manganese(II) salt Dioctadecanoic acid manganese(II) salt | [EINECS(EC#)]
222-119-9 | [Molecular Formula]
C36H70MnO4 | [MDL Number]
MFCD00050718 | [MOL File]
3353-05-7.mol | [Molecular Weight]
621.88 |
| Chemical Properties | Back Directory | [storage temp. ]
Store at room temperature, keep dry and cool | [Appearance]
White to off-white Solid | [InChI]
InChI=1S/C18H36O2.Mn/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2-17H2,1H3,(H,19,20); | [InChIKey]
PGOMUAXHEQEHJB-UHFFFAOYSA-N | [SMILES]
C(CCCCCC(=O)O)CCCCCCCCCCC.[Mn] | [EPA Substance Registry System]
Manganese(II) stearate (3353-05-7) |
| Hazard Information | Back Directory | [Definition]
Manganese Stearate is an organo-metallic compound for uses requiring non-aqueous solubility, such as recent solar energy and water treatment applications. Manganese stearate was synthesized by the reaction of stearic acid with sodium hydroxide, and sodium stearate formed with manganese chloride tetrahydrate to form manganese stearate with a melting point of 100-110 °C.
|
|
| Company Name: |
Lynnchem
|
| Telephone: |
86-(0)29-85992781 17792393971 |
| Website: |
http://www.lynnchem.com/ |
| Company Name: |
Shaanxi Dideu Medichem Co. Ltd
|
| Telephone: |
+86-029-81138252 +86-173 9270 1263 |
| Website: |
https://www.chemicalbook.com/manufacturer/shaanxi-dideu-medichem-222/ |
|