| Identification | Back Directory | [Name]
4,4'-diamino-3,3'-biphenyldisulfonic acid | [CAS]
3365-90-0 | [Synonyms]
Benzidine-3,3''-disulfonic acid 4,4'-diamino-3,3'-biphenyldisulfonic acid 4,4'-diaminobiphenyl-3,3'-disulphonic acid 4,4'-Diamino-(1,1'-biphenyl)-3,3'-disulfonic acid [1,1'-Biphenyl]-3,3'-disulfonicacid, 4,4'-diaMino- 2-amino-5-(4-amino-3-sulfophenyl)benzenesulfonic acid 2-amino-5-(4-amino-3-sulfo-phenyl)benzenesulfonic acid 2-azanyl-5-(4-azanyl-3-sulfo-phenyl)benzenesulfonic acid | [Molecular Formula]
C12H12N2O6S2 | [MDL Number]
MFCD01026108 | [MOL File]
3365-90-0.mol | [Molecular Weight]
344.36 |
| Chemical Properties | Back Directory | [density ]
1.681±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C, protect from light | [pka]
-1.97±0.50(Predicted) | [Appearance]
Off-white to gray Solid | [InChI]
InChI=1S/C12H12N2O6S2/c13-9-3-1-7(5-11(9)21(15,16)17)8-2-4-10(14)12(6-8)22(18,19)20/h1-6H,13-14H2,(H,15,16,17)(H,18,19,20) | [InChIKey]
NFSOOPQRTBEFDR-UHFFFAOYSA-N | [SMILES]
C1(C2=CC=C(N)C(S(O)(=O)=O)=C2)=CC=C(N)C(S(O)(=O)=O)=C1 |
| Hazard Information | Back Directory | [Description]
4,4'-diamino-3,3'-biphenyldisulfonic acid is virtually insoluble in alcohol and ether, very slightly soluble in boiling water. Benzidine-3,3' -disulfonic acid is made by reacting one part of benzidine sulfate with two parts of sulfuric acid monohydrate at 210 ℃. | [Uses]
4,4'-Diamino-3,3'-biphenyldisulfonic acid is used as a ligand in the synthesis of MOF materials. |
|
| Company Name: |
Zhengzhou Alfachem Co., Ltd. Gold
|
| Telephone: |
0371-53765687 18937137882 |
| Website: |
https://www.chemicalbook.com/supplier/10084342/ |
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Cool Pharm, Ltd
|
| Telephone: |
021-58581007 18019463053 |
| Website: |
http://www.coolpharm.com.cn |
| Company Name: |
CHEMSOON CO.,LTD.
|
| Telephone: |
+8613761723174 |
| Website: |
http://www.chemsoon.com/ |
|