| Identification | Back Directory | [Name]
Pyridazine-4-carboxylic acid methyl ester | [CAS]
34231-77-1 | [Synonyms]
4-Methoxycarbonylpyridazine
Methyl 4-pyridazinecarboxylate
Methyl pyridazine-4-carboxylate, 96%
4-Pyridazinecarboxylic acid methyl ester
Pyridazine-4-carboxylic acid methyl ester
Pyridazine-4-carboxylic acid methyl ester ISO 9001：2015 REACH | [Molecular Formula]
C6H6N2O2 | [MDL Number]
MFCD09953488 | [MOL File]
34231-77-1.mol | [Molecular Weight]
138.124 |
| Chemical Properties | Back Directory | [Melting point ]
64-67℃ | [Boiling point ]
281.3±13.0 °C(Predicted) | [density ]
1.213±0.06 g/cm3(Predicted) | [storage temp. ]
Sealed in dry,Room Temperature | [form ]
solid | [pka]
0.67±0.10(Predicted) | [Water Solubility ]
Slightly soluble in water. | [InChI]
InChI=1S/C6H6N2O2/c1-10-6(9)5-2-3-7-8-4-5/h2-4H,1H3 | [InChIKey]
IJFLWNYKGMQQOW-UHFFFAOYSA-N | [SMILES]
C1=NN=CC=C1C(OC)=O |
| Hazard Information | Back Directory | [Uses]
It is used to produce 4-Pyridazincarbohydroxamsaeure by heating and requires a reagent hydroxylammoniumchloride and Na2CO3. Meanwhile, it needs solvent methanol. |
|
| Company Name: |
Alfa Aesar
|
| Telephone: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Tetranov Biopharm
|
| Telephone: |
13526569071 |
| Website: |
http://www.leadmedpharm.com/index.html |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
NovoChemy Ltd.
|
| Telephone: |
86-(0)21-31261262 373522135 |
| Website: |
www.novochemy.com |
|