| Identification | Back Directory | [Name]
(-)-DI[(1R)-MENTHYL] FUMARATE | [CAS]
34675-24-6 | [Synonyms]
(-)-DIMENTHYL FUMARATE
(-)-DI[(1R)-MENTHYL] FUMARATE
Menthol, fumarate (2:1), (1R,3R,4S)-
Fumaric acid bis[(1R,1β,4S)-p-menthane-3β-yl] ester
Fumaric acid bis[(1R,1β,4α)-p-menthane-3β-yl] ester
Bis(2-isopropyl-5-methylcyclohexyl) (2E)-2-butenedioate
Bis((1R,2S,5R)-2-isopropyl-5-methylcyclohexyl) fumarate
Fumaric acid bis[(1R,2S,5R)-2-isopropyl-5-methylcyclohexyl] ester
Fumaric acid bis[(1R)-2α-isopropyl-5β-methylcyclohexane-1β-yl] ester
(E)-2-Butenedioic acid bis[(1R)-5β-methyl-2α-isopropylcyclohexan-1β-yl] ester
2-Butenedioic acid (2E)-, bis[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl] ester
2-Butenedioic acid (E)-, bis(5-methyl-2-(1-methylethyl)cyclohexyl) ester, (1R-(1alpha(1R*,2S*,5R*),2beta,5alpha))- | [Molecular Formula]
C24H40O4 | [MDL Number]
MFCD00075423 | [MOL File]
34675-24-6.mol | [Molecular Weight]
392.57 |
| Chemical Properties | Back Directory | [Melting point ]
59-61 °C (lit.) | [Boiling point ]
211 °C/5 mmHg (lit.) | [density ]
0.9985 (rough estimate) | [refractive index ]
1.4460 (estimate) | [form ]
Low Melting Solid or Powder | [color ]
Colorless to off-white | [Optical Rotation]
[α]20/D 102°, c = 1 in chloroform | [BRN ]
2568525 | [InChIKey]
HTJZKHLYRXPLLS-NGHDTEGZSA-N | [SMILES]
C[C@@H]1CC[C@@H](C(C)C)[C@@H](C1)OC(=O)\C=C\C(=O)O[C@@H]2C[C@H](C)CC[C@H]2C(C)C |
| Hazard Information | Back Directory | [Uses]
(-)-Dimenthyl Fumarate is used as a reagent in organic chemical synthesis of several compounds including that of pentacyclic steroids via tandem stille coupling. It was also used in synthesis of Lobucavir (L469360) which is an antiviral agent. |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
3A Chemicals
|
| Telephone: |
400-668-9898 |
| Website: |
www.3achem.com |
| Company Name: |
sgtlifesciences pvt ltd
|
| Telephone: |
+91-8790379245 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList1846349/0.htm |
|