| Identification | Back Directory | [Name]
PERFLUORODECENE-1 | [CAS]
35328-43-9 | [Synonyms]
perfluorodecene PERFLUORDECENE-1 PERFLUORODECENE-1 PERFLUORODEC-1-ENE Perfluoro-1-decene Perfluorodec-1-ene 95% 1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Icosafluoro-1-decene 1-Decene, 1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-eicosafluoro- | [EINECS(EC#)]
252-514-1 | [Molecular Formula]
C10F20 | [MDL Number]
MFCD04038335 | [MOL File]
35328-43-9.mol | [Molecular Weight]
500.08 |
| Chemical Properties | Back Directory | [Boiling point ]
153.3±8.0 °C(Predicted) | [density ]
1.688±0.06 g/cm3(Predicted) | [InChI]
1S/C10F20/c11-1(2(12)13)3(14,15)4(16,17)5(18,19)6(20,21)7(22,23)8(24,25)9(26,27)10(28,29)30 | [InChIKey]
IMVVEWPCRIJQCA-UHFFFAOYSA-N | [SMILES]
FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=C(F)F)F | [EPA Substance Registry System]
Perfluoro-1-decene (35328-43-9) |
| Hazard Information | Back Directory | [Uses]
Perfluorodecene-1 (CAS# 35328-43-9) is a perfluoroalkane, a group of emerging pollutants. Perfluorodecene-1 has been used as a tuning modifier in synthesized membranes for oil-soluble drugs, modifying the pore size, porosity, surface area, surface roughness, and super-hydrophobicity. |
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
A.J Chemicals
|
| Tel: |
91-9810153283 |
| Website: |
www.ajchemicals.com |
| Company Name: |
Leancare Ltd.
|
| Tel: |
+33 962096793 |
| Website: |
www.leancare.co.uk |
|