| Identification | Back Directory | [Name]
SAMARIUM TRIS(HEXAMETHYLDISILAZIDE) | [CAS]
35789-01-6 | [Synonyms]
)amide]samarium(III) samarium tris(hexamethylsilazide) samarium tris(hexamethyldisilazde) SAMARIUM TRIS(HEXAMETHYLDISILAZIDE) tris(bis(trimethylsilyl)amino)samarium Tris[N,N-bis(trimethylsilyl)amide]samarium TRIS[N,N-BIS(TRIMETHYLSILYL)AMIDE]SAMARIUM(III) Tris(1,1,1,3,3,3-hexamethyldisilazanato)samarium Tris[N,N-bis(triMethylsilyl)aMide]saMariuM [[(CH3)3Si]2N]3SM 1,1,1-Trimethyl-N-(trimethylsilyl)silanamine samarium(III) salt Tris[N,N-bis(trimethylsilyl)amide]samarium [[(CH3)3Si]2N]3Sm FW 631.51 M.p. 93-1060C | [Molecular Formula]
C18H54N3Si6Sm | [MDL Number]
MFCD03427097 | [MOL File]
35789-01-6.mol | [Molecular Weight]
631.51 |
| Chemical Properties | Back Directory | [Melting point ]
93-106 °C(lit.) | [Boiling point ]
83-4°C/1x10-4mmHg | [Fp ]
36 °F | [form ]
solid | [InChI]
1S/3C6H18NSi2.Sm/c3*1-8(2,3)7-9(4,5)6;/h3*1-6H3;/q3*-1;+3 | [InChIKey]
MUFPZLRACJKLCI-UHFFFAOYSA-N | [SMILES]
C[Si](C)(C)N([Sm](N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
| Hazard Information | Back Directory | [Uses]
Reactant for synthesis of:
- Heterobimetallic samarium(III) complexes
- Binuclear lanthanide complexes
Catalyst for:
- Coordination polymerization of renewable butyrolactone-based vinyl monomers
- Intramolecular hydroamination of non-activated alkenes
- Chiral functionalization of isoxazoles
- Enantioselective hydroamination / cyclization
| [reaction suitability]
core: samarium reagent type: catalyst |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
3A Chemicals
|
| Tel: |
400-668-9898 |
| Website: |
www.3achem.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Ereztech LLC
|
| Tel: |
1.888.658.1221 |
| Website: |
www.ereztech.com |
|