| Identification | Back Directory | [Name]
rac trans-Loxoprofen Alcohol | [CAS]
371753-19-4 | [Synonyms]
rac trans-Loxoprofen Alcohol
Loxoprofen rac-trans Alcohol Impurity
Loxoprofen Impurity 18(Mixture of Isomers)
trans-Hydroxy Loxoprofen (Mixture of Isomers)
trans-Loxoprofen Alcohol (Mixture of isomers)
trans-Hydroxy Loxoprofen-13C-d3 (Mixture of Diastereomers)
trans-2-(4-((2-hydroxycyclopentyl)methyl)phenyl)propanoic acid
rel-4-[[(1R,2S)-2-hydroxycyclopentyl]Methyl]-α-Methylbenzeneacetic Acid
Benzeneacetic acid, 4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-α-methyl-, rel-
rac trans-Loxoprofen-d3 AlcoholQ: What is
rac trans-Loxoprofen-d3 Alcohol Q: What is the CAS Number of
rac trans-Loxoprofen-d3 Alcohol | [Molecular Formula]
C15H20O3 | [MDL Number]
MFCD30720493 | [MOL File]
371753-19-4.mol | [Molecular Weight]
248.32 |
| Chemical Properties | Back Directory | [Boiling point ]
418.6±20.0 °C(Predicted) | [density ]
1.189±0.06 g/cm3(Predicted) | [solubility ]
Chloroform (Slightly), Methanol (Slightly) | [form ]
Solid | [pka]
4.42±0.10(Predicted) | [color ]
White to Off-White | [InChI]
InChI=1/C15H20O3/c1-10(15(17)18)12-7-5-11(6-8-12)9-13-3-2-4-14(13)16/h5-8,10,13-14,16H,2-4,9H2,1H3,(H,17,18)/t10?,13-,14+/s3 | [InChIKey]
SHAHPWSYJFYMRX-QOABLFOCNA-N | [SMILES]
C([C@H]1CCC[C@@H]1O)C1C=CC(C(C)C(=O)O)=CC=1 |&1:1,5,r| |
|
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.bocsci.com |
|