| Identification | Back Directory | [Name]
Wang-Yu non-directed C-H functionalization ligand | [CAS]
38609-76-6 | [Synonyms]
3,5-Bis(trifluoromethyl)pyridin-2-ol 3,5-bis(trifluoromethyl)-2-hydroxypyridine 2(1H)-Pyridinone, 3,5-bis(trifluoromethyl)- Wang-Yu non-directed C-H functionalization ligand | [Molecular Formula]
C7H3F6NO | [MDL Number]
MFCD28802532 | [MOL File]
38609-76-6.mol | [Molecular Weight]
231.1 |
| Chemical Properties | Back Directory | [Melting point ]
145 °C | [storage temp. ]
-20°C | [form ]
powder or crystals | [Appearance]
White to off-white Solid | [InChIKey]
IWSJDZMIJFAEBO-UHFFFAOYSA-N | [SMILES]
FC(F)(F)c1c(ncc(c1)C(F)(F)F)O |
| Hazard Information | Back Directory | [Uses]
This 2-pyridone ligand developed in the laboratory of Jin-Quan Yu binds to palladium and accelerates non-directed C-H functionalization. Developed for C-H olefination and carboxylation with arene as the limiting reagent, the Wang-Yu ligand enables diversification of drugs, synthetic intermediates, and other bioactive small molecules. | [reaction suitability]
reaction type: C-C Bond Formation reagent type: catalyst reaction type: C-H Activation |
|
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Cochemical Ltd.
|
| Telephone: |
029-86115547 17791676824 |
| Website: |
http://www.cochemical.com |
| Company Name: |
Cochemical Co. Ltd.
|
| Telephone: |
+86-029-86115547 +86-17791676824 |
| Website: |
www.cochemical.com |
|