| Identification | Back Directory | [Name]
2'-HYDROXY-2,3-DIMETHOXYCHALCONE | [CAS]
42220-80-4 | [Synonyms]
LABOTEST-BB LT00453745 2'-HYDROXY-2,3-DIMETHOXYCHALCONE 2,3-DIMETHOXY-2'-HYDROXYCHALCONE DIMETHOXY-2'-HYDROXYCHALCONE, 2,3- 2-Propen-1-one, 3-(2,3-dimethoxyphenyl)-1-(2-hydroxyphenyl)- | [Molecular Formula]
C17 H16 O4 | [MDL Number]
MFCD00016444 | [MOL File]
42220-80-4.mol | [Molecular Weight]
284.31 |
| Chemical Properties | Back Directory | [Melting point ]
100~102℃ | [Boiling point ]
453.2±45.0 °C(Predicted) | [density ]
1.203±0.06 g/cm3(Predicted) | [form ]
solid | [pka]
7.66±0.30(Predicted) | [InChI]
1S/C17H16O4/c1-20-16-9-5-6-12(17(16)21-2)10-11-15(19)13-7-3-4-8-14(13)18/h3-11,18H,1-2H3/b11-10+ | [InChIKey]
HKKXNGSRSNONCJ-ZHACJKMWSA-N | [SMILES]
COc1cccc(\C=C\C(=O)c2ccccc2O)c1OC | [LogP]
3.890 (est) |
| Hazard Information | Back Directory | [Uses]
α-Gracinoic acid is a Chalcone (HY-121054) derivative with anti-inflammatory activity. α-Gracinoic acid inhibits nitric oxide production catalyzed by inducible nitric oxide synthase (iNOS) in lipopolysaccharide (LPS)-treated RAW 264.7 cells[1]. | [References]
[1] Kim, et al. "Anti-inflammatory activity of the synthetic chalcone derivatives: inhibition of inducible nitric oxide synthase-catalyzed nitric oxide production from lipopolysaccharide-treated RAW 264.7 cells." Biological and Pharmaceutical Bulletin 30.8 (2007): 1450-1455. DOI:10.1248/bpb.30.1450 |
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Carbosynth
|
| Tel: |
+86 512 6260 5585 |
| Website: |
www.carbosynth.com |
| Company Name: |
Leancare Ltd.
|
| Tel: |
+33 962096793 |
| Website: |
www.leancare.co.uk |
|