| Identification | Back Directory | [Name]
4-METHYL-2-PENTANONE-1,1,1,3,3-D5 | [CAS]
4840-81-7 | [Synonyms]
Isopropylacetone-D5 4-Methyl-2-pentanone--d5 Deuterated 4-methyl-2-pentanone Deuterated methyl isobutyl ketone 4-METHYL-2-PENTANONE-1,1,1,3,3-D5 4-Methyl-2-pentanone-1,1,1,3,3-d? 2-Pentanone, 4-methyl-1,1,1,3,3-[D5 4-Methyl-2-pentanone-d5 in Acetonitrile 1,1,1,3,3-pentadeuterio-4-methylpentan-2-one 1,1,1,3,3-pentadeuterio-4-methyl-pentan-2-one 4-METHYL-2-PENTANONE-1,1,1,3,3-D5, 98 AT OM % D | [Molecular Formula]
C6H12O | [MDL Number]
MFCD01074182 | [MOL File]
4840-81-7.mol | [Molecular Weight]
100.16 |
| Chemical Properties | Back Directory | [Melting point ]
−80 °C(lit.) | [Boiling point ]
117-118 °C (lit.) | [density ]
0.841 g/mL at 25 °C | [refractive index ]
n20/D 1.396(lit.) | [Fp ]
56 °F | [solubility ]
Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) Water (Slightly) | [form ]
Oil | [color ]
Colourless | [InChI]
1S/C6H12O/c1-5(2)4-6(3)7/h5H,4H2,1-3H3/i3D3,4D2 | [InChIKey]
NTIZESTWPVYFNL-IKISXXDZSA-N | [SMILES]
[2H]C([2H])([2H])C(=O)C([2H])([2H])C(C)C |
| Hazard Information | Back Directory | [Uses]
4-Methyl-2-pentanone-d5 is the isotope labelled analog of 4-Methyl-3-pentanone (M328025), a reactant used to synthesize 2-(1-Hydroxy-3-methylbutylidene)-1H-indene-1,3(2H)-dione (H953650). |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|