| Identification | Back Directory | [Name]
flufenacet-alcohol | [CAS]
54041-17-7 | [Synonyms]
flufenacet-alcohol flufenacet-hydroxy flufenacet-alcohol ISO 9001:2015 REACH 4'-Fluoro-N-isopropyl-2-hydroxyacetanilide Chlorimuron Impurity 11 (Ethametsulfuron-methyl) N-(4-fluorophenyl)-2-hydroxy-N-isopropylacetamide N-(4-fluorophenyl)-2-hydroxy-N-propan-2-ylacetamide N-(4-fluorophenyl)-2-hydroxy-N-(1-methylethyl)acetamide Acetamide, N-(4-fluorophenyl)-2-hydroxy-N-(1-m ethylethyl)- | [EINECS(EC#)]
611-084-9 | [Molecular Formula]
C11H14FNO2 | [MOL File]
54041-17-7.mol | [Molecular Weight]
211.23 |
| Chemical Properties | Back Directory | [Boiling point ]
323.8±27.0 °C(Predicted) | [density ]
1.199±0.06 g/cm3(Predicted) | [vapor pressure ]
0.083-0.522Pa at 20-50℃ | [form ]
Solid | [pka]
12.97±0.10(Predicted) | [InChI]
InChI=1S/C11H14FNO2/c1-8(2)13(11(15)7-14)10-5-3-9(12)4-6-10/h3-6,8,14H,7H2,1-2H3 | [InChIKey]
RISGISSUGUGJMO-UHFFFAOYSA-N | [SMILES]
C(N(C1=CC=C(F)C=C1)C(C)C)(=O)CO | [LogP]
1.6 at 30℃ and pH6-8 | [Surface tension]
58mN/m at 1.001g/L and 20℃ | [EPA Substance Registry System]
Acetamide, N-(4-fluorophenyl)-2-hydroxy-N-(1-methylethyl)- (54041-17-7) |
|
| Company Name: |
Qi-Chem Co., Ltd.
|
| Telephone: |
0411-88165951 13601035838 |
| Website: |
http://www.qi-chem.com/ |
| Company Name: |
Bide Pharmatech Ltd.
|
| Telephone: |
400-1647117 13681763483 |
| Website: |
https://www.bidepharm.com/ |
|