| Identification | Back Directory | [Name]
2,5-Dimethylphenylacetyl chloride | [CAS]
55312-97-5 | [Synonyms]
2,5-Dimethylphenylacetyl chloride 2,5-Dimethyl phenyl acetic chloride 2,5-DimethylphenylacetylChloride> 2-(2,5-Dimethylphenyl)acetyl Chloride Benzeneacetyl chloride, 2,5-dimethyl- | [Molecular Formula]
C10H11ClO | [MDL Number]
MFCD12024950 | [MOL File]
55312-97-5.mol | [Molecular Weight]
182.65 |
| Chemical Properties | Back Directory | [Boiling point ]
260.3±19.0 °C(Predicted) | [density ]
1.11 | [refractive index ]
1.5290 to 1.5330 | [form ]
clear liquid | [color ]
Colorless to Yellow | [InChI]
InChI=1S/C10H11ClO/c1-7-3-4-8(2)9(5-7)6-10(11)12/h3-5H,6H2,1-2H3 | [InChIKey]
PZRANTBLOIKHJY-UHFFFAOYSA-N | [SMILES]
C1(CC(Cl)=O)=CC(C)=CC=C1C |
|
| Company Name: |
Qi-Chem Co., Ltd. Gold
|
| Tel: |
0411-88165951 13601035838 |
| Website: |
http://www.qi-chem.com/ |
|