| Identification | Back Directory | [Name]
(R)-(-)-BENZOIN | [CAS]
5928-66-5 | [Synonyms]
(R)-(-)-BENZOIN (R)-(-)-Benzoin 98% (R)-(-)-BENZOIN, 98% (99% EE/HPLC) (R)-2-HYDROXY-2-PHENYLACETOPHENONE Ethanone, 2-hydroxy-1,2-diphenyl-, (2R)- | [Molecular Formula]
C14H12O2 | [MDL Number]
MFCD00082818 | [MOL File]
5928-66-5.mol | [Molecular Weight]
212.24 |
| Chemical Properties | Back Directory | [Melting point ]
135-137 °C (lit.) | [Boiling point ]
343.0±0.0 °C(Predicted) | [density ]
1.179±0.06 g/cm3(Predicted) | [pka]
12.28±0.20(Predicted) | [Optical Rotation]
[α]24/D 115°, c = 1.5 in acetone | [InChI]
1S/C14H12O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13,15H/t13-/m1/s1 | [InChIKey]
ISAOCJYIOMOJEB-CYBMUJFWSA-N | [SMILES]
O[C@H](c1ccccc1)C(=O)c2ccccc2 | [LogP]
2.130 (est) |
| Hazard Information | Back Directory | [Uses]
(R)-(-)-Benzoin may be used in the preparation of (R)-2-hydroxy-1-phenylpropanone by reacting with benzaldehyde lyase (BAL) in the presence of acetaldehyde. | [Definition]
ChEBI: (R)-benzoin is a benzoin. It is an enantiomer of a (S)-benzoin. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
BOC Sciences
|
| Tel: |
|
| Website: |
https://www.bocsci.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
A.J Chemicals
|
| Tel: |
91-9810153283 |
| Website: |
www.ajchemicals.com |
|