| Identification | More | [Name]
(1S)-10-CAMPHORSULFONAMIDE | [CAS]
60933-63-3 | [Synonyms]
(1S)-(+)-10-CAMPHORSULFONAMIDE (1S)-10-CAMPHORSULFONAMIDE (S)-10-CAMPHORSULFONAMIDE Camphorsulfonamide | [Molecular Formula]
C10H17NO3S | [MDL Number]
MFCD00075611 | [Molecular Weight]
231.31 | [MOL File]
60933-63-3.mol |
| Chemical Properties | Back Directory | [Appearance]
Off-White Solid | [Melting point ]
129-132 °C (lit.) | [Boiling point ]
380.4±34.0 °C(Predicted) | [density ]
1.280±0.06 g/cm3(Predicted) | [solubility ]
Dichloromethane | [form ]
Powder | [pka]
10.14±0.60(Predicted) | [color ]
Off-White | [Optical Rotation]
[α]20/D +22°, c = 1 in methanol | [Usage]
A useful synthetic intermediate. Used for asymmetric hydroxylation | [InChI]
1S/C10H17NO3S/c1-9(2)7-3-4-10(9,8(12)5-7)6-15(11,13)14/h7H,3-6H2,1-2H3,(H2,11,13,14)/t7-,10-/m1/s1 | [InChIKey]
SBLUNABTQYDFJM-GMSGAONNSA-N | [SMILES]
CC1(C)[C@@H]2CC[C@@]1(CS(N)(=O)=O)C(=O)C2 | [CAS DataBase Reference]
60933-63-3(CAS DataBase Reference) |
| Hazard Information | Back Directory | [Chemical Properties]
Off-White Solid | [Uses]
(1S)-(+)-10-Camphorsulfonamide is a useful synthetic intermediate. Used for asymmetric hydroxylation
| [Uses]
An amino chiral derivative of Camphor | [Uses]
An amino chiral derivative of Camphor. |
|
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|