| Identification | Back Directory | [Name]
2,7-Dichloro-9-fluorenone | [CAS]
6297-11-6 | [Synonyms]
2,7-dichlorofluorone 2,7-DICHLORO-9-FLUORENONE 2,7-dichloro-9H-9-fluorenone 2,7-Dichloro-9H-fluoren-9-one 9H-Fluoren-9-one, 2,7-dichloro- 2,7-Dichloro-9-fluorenone technical grade, 90% | [Molecular Formula]
C13H6Cl2O | [MDL Number]
MFCD00010791 | [MOL File]
6297-11-6.mol | [Molecular Weight]
249.09 |
| Chemical Properties | Back Directory | [Melting point ]
192-194 °C(lit.)
| [InChI]
1S/C13H6Cl2O/c14-7-1-3-9-10-4-2-8(15)6-12(10)13(16)11(9)5-7/h1-6H | [InChIKey]
HEYWYQQFXVEUSH-UHFFFAOYSA-N | [SMILES]
Clc1ccc2-c3ccc(Cl)cc3C(=O)c2c1 |
| Hazard Information | Back Directory | [Uses]
2,7-Dichloro-9-fluorenone may be used in chemical synthesis. | [Synthesis]
A method for the oxidation of fluorene compounds to prepare the 9-fluorenone analog 2,7-dichloro-9-fluorenone, comprising the steps of adding 20 g of 2,7-dichlorofluorene (0.085 mol), 120 ml of tetrahydrofuran, and 7.15 g of potassium hydroxide (0.128 mol |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|