| Identification | Back Directory | [Name]
N-[4-(Methylamino)benzoyl]-L-glutamic acid zinc salt | [CAS]
66104-81-2 | [Synonyms]
JACS-66104-81-2
L(+)-N-(P-Methylamino Benzoyl)glutamate zinc
N-[4-(Methylamino)benzoyl]-L-glutamic acid zinc salt
Zinc(II) (S)-2-(4-(methylamino)benzamido)pentanedioate
zinc,(2S)-2-[[4-(methylamino)benzoyl]amino]pentanedioate
N-[4-(Methylamino)benzoyl]-L-glutamic acid zinc salt USP/EP/BP | [EINECS(EC#)]
1533716-785-6 | [Molecular Formula]
C13H14N2O5Zn | [MDL Number]
MFCD08063879 | [MOL File]
66104-81-2.mol | [Molecular Weight]
343.651 |
| Chemical Properties | Back Directory | [InChI]
InChI=1S/C13H16N2O5.Zn/c1-14-9-4-2-8(3-5-9)12(18)15-10(13(19)20)6-7-11(16)17;/h2-5,10,14H,6-7H2,1H3,(H,15,18)(H,16,17)(H,19,20);/q;+2/p-2 | [InChIKey]
HKSAKGRLQPUPIZ-UHFFFAOYSA-L | [SMILES]
C(C1C([O-][Zn+2]O=C(C2C=CC(NC)=CC=2)N1)=O)CC(=O)[O-] |
| Hazard Information | Back Directory | [Agricultural Uses]
N-[4-(Methylamino)benzoyl]-L-glutamic acid zinc salt is used as a
herbicide for the purpose of controlling and eliminating unwanted plant
growth. It is particularly effective in targeting broadleaf and grassy
weeds in various crops, such as soybeans, corn, and wheat. The
application reason is its ability to disrupt the nitrogen metabolism in
plants, causing their death and thus preventing competition for
resources with the desired crops. |
|
|