| Identification | Back Directory | [Name]
TETRAMETHYLRHODAMINE | [CAS]
70281-37-7 | [Synonyms]
TAMRA-azide
Azide-fluor 545
TAMRA PEG azide.
TETRAMETHYLRHODAMINE
tetramethylrhodamine chloride
5-Carboxytetramethylrhodamine-azide
[9-(2-carboxyphenyl)-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium | [Molecular Formula]
C24H23ClN2O3 | [MDL Number]
MFCD00269785 | [MOL File]
70281-37-7.mol | [Molecular Weight]
422.9 |
| Chemical Properties | Back Directory | [storage temp. ]
-20°C | [solubility ]
DMSO, DMF | [form ]
solid | [Appearance]
Dark red amorphous solid | [InChI]
InChI=1S/C24H22N2O3.ClH/c1-25(2)15-9-11-19-21(13-15)29-22-14-16(26(3)4)10-12-20(22)23(19)17-7-5-6-8-18(17)24(27)28;/h5-14H,1-4H3;1H | [InChIKey]
WGTODYJZXSJIAG-UHFFFAOYSA-N | [SMILES]
C1(C2C=CC=CC=2C(=O)O)=C2C=C/C(=[N+](/C)\C)/C=C2OC2C=C(N(C)C)C=CC1=2.[Cl-] |
| Hazard Information | Back Directory | [Description]
The red-fluorescent TAMRA Azide (TAMRA-PEG4-Azide) can be reacted with terminal alkynes via a copper-catalyzed click reaction (CuAAC). It also reacts with strained cyclooctyne via a copper-free “click chemistry” reaction to form a stable triazole and does not require Cu-catalyst or elevated temperatures.TAMRA (tetramethylrhodamine) is a bright fluorescent label is compatible with various excitation sources including mercury arc, tungsten and xenon arc lamps, the 544 nm line of the Helium-Neon laser and the 532 nm green laser line. | [Uses]
Can be used to detect or label alkyne- or cyclooctyne-containing molecules or biomolecules by fluorescence spectroscopy following an azide-alkyne click chemistry reaction.
Spectral Properties: Abs/Em = 546/565 nm | [Definition]
ChEBI: Tetramethylrhodamine chloride is an organic chloride salt. It has a role as a fluorochrome. It contains a tetramethylrhodamine. | [reaction suitability]
reaction type: click chemistry | [Abs/Em Maxima]
553/575 nm | [Extinction Coefficient]
92,000 | [Spectrally Similar Dyes]
Alexa Fluor® 546, Atto™ 543, CF® 543 Dye |
|
| Company Name: |
SynAsst Chemical.
|
| Tel: |
021-60343070 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15848/0_EN.htm |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|