| Identification | Back Directory | [Name]
Levomepromazine maleate | [CAS]
7104-38-3 | [Synonyms]
Sofmin Neruocil Neuractil Levohalte Neurocil (tablet) Levomepromazine meleate Levomepromazine maleate RP 7044 hydrogen maleate Levomepromazine maleate CRS Levomepromazine·maleic acid Levomepromazine maleate salt 2-Methoxytrimeprazine maleate LevoMeproMazine Hydrogen Maleate Levomepromazine maleate USP/EP/BP 10-(3-Dimethylamino-2-methylpropyl)-2-methoxyphenothiazine maleate (2R)-3-(2-Methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethylpropylamine Maleate (R)-3-(2-Methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine Maleate (βR)-2-Methoxy-N,N,β-triMethyl-10H-phenothiazine-10-propanaMine (2Z)-2-Butenedioate 10H-Phenothiazine-10-propanamine, 2-methoxy-N,N,b-trimethyl-, (R)-, (Z)-2-butenedioate (1:1) 10H-Phenothiazine-10-propanamine, 2-methoxy-N,N,b-trimethyl-, (bR)-, (2Z)-2-butenedioate (1:1) (9CI) 10H-Phenothiazine-10-propanamine, 2-methoxy-N,N,.beta.-trimethyl-, (.beta.R)-, (2Z)-2-butenedioate (1:1) Levomepromazine maleateQ: What is
Levomepromazine maleate Q: What is the CAS Number of
Levomepromazine maleate Q: What is the storage condition of
Levomepromazine maleate Q: What are the applications of
Levomepromazine maleate Levomepromazine-D6 maleateQ: What is
Levomepromazine-D6 maleate Q: What is the CAS Number of
Levomepromazine-D6 maleate Q: What is the storage condition of
Levomepromazine-D6 maleate Q: What are the applications of
Levomepromazine-D6 maleate | [EINECS(EC#)]
230-412-8 | [Molecular Formula]
C19H24N2OS.C4H4O4 | [MOL File]
7104-38-3.mol | [Molecular Weight]
444.54 |
| Chemical Properties | Back Directory | [Melting point ]
176-179°C | [alpha ]
D20 -17° (c = 5 in chloroform) | [storage temp. ]
-20°C Freezer | [solubility ]
Chloroform (Slightly), DMF (Slightly), Methanol (Slightly) | [form ]
neat | [color ]
Off-White to Pale Beige | [Major Application]
pharmaceutical (small molecule) | [InChIKey]
IFLZPECPTYCEBR-VIEYUMQNSA-N | [SMILES]
S1c2c(cc(cc2)OC)N(c3c1cccc3)C[C@@H](CN(C)C)C.OC(=O)\C=C/C(=O)O |
| Hazard Information | Back Directory | [Chemical Properties]
Pale Beige Solid | [Uses]
Antipsychotic | [Uses]
The (R) optical isomer of Methotrimeprazine (M260785), an analgesic/neuroleptic. | [Brand name]
Nozinan (Aventis); Tisercin (Egis). |
|
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
|