Identification | Back Directory | [Name]
1-(2,4-Dihydroxy-5-isopropylphenyl)ethanone | [CAS]
747414-17-1 | [Synonyms]
CaMbridgeSoft Licensing Violation 2’,4’-Dihydroxy-5’-isopropylacetophenone 1-(2,4-Dihydroxy-5-isopropylphenyl)ethanone 1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethanone 1-(2,4-dihydroxy-5-isopropylphenyl)ethan-1-one Ethanone, 1-[2,4-dihydroxy-5-(1-Methylethyl)phenyl]- 1-(2,4-Dihydroxy-5-isopropylphenyl)ethanone USP/EP/BP | [Molecular Formula]
C11H14O3 | [MDL Number]
MFCD12827976 | [MOL File]
747414-17-1.mol | [Molecular Weight]
194.23 |
Chemical Properties | Back Directory | [Boiling point ]
342℃ | [density ]
1.156 | [Fp ]
175℃ | [storage temp. ]
Inert atmosphere,Room Temperature | [pka]
8.49±0.23(Predicted) | [InChI]
InChI=1S/C11H14O3/c1-6(2)8-4-9(7(3)12)11(14)5-10(8)13/h4-6,13-14H,1-3H3 | [InChIKey]
YFIAXNACMLJXRX-UHFFFAOYSA-N | [SMILES]
C(=O)(C1=CC(C(C)C)=C(O)C=C1O)C |
Hazard Information | Back Directory | [Uses]
1-(2,4-Dihydroxy-5-isopropylphenyl)ethanone acts as a reagent in the synthesis of 3,5-disubstituted-4-alkynylisoxozales as HSP90 inhibitors against various human cancer cell lines. |
|
|