| Identification | Back Directory | [Name]
2-bromo-5-methylpyridin-4-amine | [CAS]
79055-60-0 | [Synonyms]
2-bromo-5-methylpyridin-4-amine 2-Bromo-5-methyl-4-pyridinamine 4-Amino-2-bromo-5-methylpyridine 2-BroMo-4-aMino-5-Methylpyridine 4-PyridinaMine, 2-broMo-5-Methyl- 2-Bromo-5-methyl-pyridin-4-ylamine 2-bromo-5-methylpyridin-4-amine(WX192333) | [EINECS(EC#)]
946-497-6 | [Molecular Formula]
C6H7BrN2 | [MDL Number]
MFCD11100653 | [MOL File]
79055-60-0.mol | [Molecular Weight]
187.04 |
| Chemical Properties | Back Directory | [Melting point ]
125 °C | [Boiling point ]
332.2±37.0 °C(Predicted) | [density ]
1.593±0.06 g/cm3(Predicted) | [storage temp. ]
Keep in dark place,Inert atmosphere,2-8°C | [pka]
5.26±0.42(Predicted) | [Appearance]
Off-white to light yellow Solid | [InChI]
InChI=1S/C6H7BrN2/c1-4-3-9-6(7)2-5(4)8/h2-3H,1H3,(H2,8,9) | [InChIKey]
NZTRUPUDUVCDTC-UHFFFAOYSA-N | [SMILES]
C1(Br)=NC=C(C)C(N)=C1 |
| Hazard Information | Back Directory | [Uses]
2-Bromo-5-methylpyridin-4-amine can be used as organic synthesis intermediates and pharmaceutical intermediates, used in laboratory research and development processes and chemical production processes. |
|
| Company Name: |
ZEROSCHEM.CO.,LTD.
|
| Telephone: |
10-61256048 13810278579; |
| Website: |
http://www.zeroschem.com |
| Company Name: |
Shanghai Ennopharm Co., Ltd.
|
| Telephone: |
+86 (21) 6435-5022 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList13640/0_EN.htm |
| Company Name: |
Heterochem
|
| Telephone: |
027-88041443 13072715837 |
| Website: |
www.hetero-chem.com |
| Company Name: |
T&W GROUP
|
| Telephone: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
|