| Identification | Back Directory | [Name]
4,4,5,5-Tetramethyl-2-((E)-propenyl)[1,3,2]dioxaborolane | [CAS]
83947-58-4 | [Synonyms]
Trans-1-PropenyL trans-1-Propeneboronic acid pinacol ester trans-1-Propenylboronic acid pinacol ester trans-1-Propenylboronic acid pinacol ester 97% 4,4,5,5-tetramethyl-2-(1-propenyl)-1,3,2-dioxaborolane 4,4,5,5-Tetramethyl-2-((E)-propenyl)[1,3,2]dioxaborolane 4,4,5,5-Tetramethyl-2-((E)-1-propenyl)-1,3,2-dioxaborolane (E)-4,4,5,5-Tetramethyl-2-(prop-1-enyl)-1,3,2-dioxaborolane 4,4,5,5-tetramethyl-2-[(E)-prop-1-enyl]-1,3,2-dioxaborolane 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(1E)-1-propen-1-yl- (E)-4,4,5,5-Tetramethyl-2-(prop-1-en-1-yl)-1,3,2-dioxaborolane 4,4,5,5-Tetramethyl-2-[(1E)-1-propen-1-yl]-1,3,2-dioxaborolane trans-2-(1-Propen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 4,4,5,5-tetramethyl-2-[(1E)-prop-1-en-1-yl]-1,3,2-dioxaborolane4,4,5,5-tetramethyl-2-[(1E)-propan-1-ene-1-yl]-1,3,2-dioxolane | [Molecular Formula]
C9H17BO2 | [MDL Number]
MFCD15143598 | [MOL File]
83947-58-4.mol | [Molecular Weight]
168.04 |
| Chemical Properties | Back Directory | [Boiling point ]
46-47℃ (4 Torr) | [density ]
0.89±0.1 g/cm3 (20 ºC 760 Torr) | [refractive index ]
n20/D1.433 | [Fp ]
48.9±22.6℃ | [form ]
liquid | [InChI]
1S/C9H17BO2/c1-6-7-10-11-8(2,3)9(4,5)12-10/h6-7H,1-5H3/b7-6+ | [InChIKey]
COPMASWDWLENMV-VOTSOKGWSA-N | [SMILES]
C\C=C\B1OC(C)(C)C(C)(C)O1 |
| Safety Data | Back Directory | [Risk Statements ]
10 | [RIDADR ]
UN 1993C 3 / PGIII | [WGK Germany ]
3 | [Storage Class]
3 - Flammable liquids | [Hazard Classifications]
Flam. Liq. 3 |
| Hazard Information | Back Directory | [Uses]
(E)-1-Propenylboronic Pinacol Ester is an intermediate in the synthesis of trans-2-Methyl-cyclopropyl Boronic Acid Pinacol Ester (M338290). |
|
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Wuxi AppTec
|
| Telephone: |
022-59987777 13552403979 |
| Website: |
www.labnetwork.com |
| Company Name: |
3A Chemicals
|
| Telephone: |
400-668-9898 |
| Website: |
www.3achem.com |
| Company Name: |
Bide Pharmatech Ltd.
|
| Telephone: |
400-1647117 13681763483 |
| Website: |
https://www.bidepharm.com/ |
|