| Identification | Back Directory | [Name]
Piperazine | [CAS]
849482-21-9 | [Synonyms]
Piperazine dihydrochloride-d8 Piperazine-d8 Dihydrochloride [2H8]-Piperazine Dihydrochloride Piperazine-D8 DihydrochlorideQ: What is
Piperazine-D8 Dihydrochloride Q: What is the CAS Number of
Piperazine-D8 Dihydrochloride Q: What is the storage condition of
Piperazine-D8 Dihydrochloride Q: What are the applications of
Piperazine-D8 Dihydrochloride | [Molecular Formula]
C4H10N2 | [MOL File]
849482-21-9.mol | [Molecular Weight]
86.1356 |
| Chemical Properties | Back Directory | [Melting point ]
>240°C (dec.) | [storage temp. ]
Refrigerator | [solubility ]
DMSO (Slightly, Heated, Sonicated), Methanol (Slightly), Water (Sparingly) | [form ]
Solid | [color ]
White to Off-White | [Stability:]
Hygroscopic | [InChI]
1S/C4H10N2.2ClH/c1-2-6-4-3-5-1;;/h5-6H,1-4H2;2*1H/i1D2,2D2,3D2,4D2;; | [InChIKey]
CVVIJWRCGSYCMB-VHGLFXLXSA-N | [SMILES]
Cl.Cl.[2H]C1([2H])NC([2H])([2H])C([2H])([2H])NC1([2H])[2H] | [CAS Number Unlabeled]
142-64-3 |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|