| Identification | Back Directory | [Name]
2,4-di-tert-butyl-5-nitrophenyl methyl carbonate | [CAS]
873055-55-1 | [Synonyms]
IvacaftorImpurity4-d20
2,4-Di-Tert-Butyl-5-Nitrophenyl
,4-di-tert-butyl-5-nitrophenyl methyl carbonate
5-nitro-2,4-di-tert-butylphenyl methyl carbonate
2,4-di-tert-butyl-5-nitrophenyl methyl carbonate
2,4-bis(1,1-dimethylethyl)-5-nitrophenyl methyl ester
Carbonicacid, 2,4-bis(1,1-dimethylethyl)-5-nitrophenyl methy...
Carbonic acid 2,4-bis(1,1-dimethylethyl)-5-nitrophenyl methyl ester
2,4-Di-tert-butyl-5-nitrophenyl methyl carbonate
Carbonic acid 2,4-bis(1,1-dimethylethyl)-5-nitrophenyl methyl ester
2,4-Di-tert-butyl-5-nitrophenyl-d10 Methyl CarbonateQ: What is
2,4-Di-tert-butyl-5-nitrophenyl-d10 Methyl Carbonate Q: What is the CAS Number of
2,4-Di-tert-butyl-5-nitrophenyl-d10 Methyl Carbonate | [Molecular Formula]
C16H23NO5 | [MDL Number]
MFCD11113067 | [MOL File]
873055-55-1.mol | [Molecular Weight]
309.36 |
| Chemical Properties | Back Directory | [Boiling point ]
384℃ | [density ]
1.110 | [Fp ]
135℃ | [InChI]
InChI=1S/C16H23NO5/c1-15(2,3)10-8-11(16(4,5)6)13(22-14(18)21-7)9-12(10)17(19)20/h8-9H,1-7H3 | [InChIKey]
QBDLLAFFRJOLHZ-UHFFFAOYSA-N | [SMILES]
C(OC)(=O)OC1=CC([N+]([O-])=O)=C(C(C)(C)C)C=C1C(C)(C)C |
| Hazard Information | Back Directory | [Uses]
5-Nitro-2,4-bis(1,1-dimethylethyl)phenyl-carbonic Acid Methyl Ester-d10 is an intermediate used in the synthesis of Ivacaftor (4-tertbutyl-d9) (Major) (I940603), which is isotopically labeled form of Ivacaftor (I940600), that is used in the treatment of cystic fibrosis. |
|
| Company Name: |
Lakshmi Farmachem
|
| Tel: |
+91-9948795885 +91-9550886476 |
| Website: |
www.lakshmifarmachem.com |
|