| Identification | Back Directory | [Name]
1-BOC-indole-3-boronic acid, pinacol ester | [CAS]
942070-45-3 | [Synonyms]
N-BOC-Indole-3-boronic acid N-boc-Indole-3-toronicacidpinacolester N-boc-Indole-3-boronic acid pinacol ester 1-BOC-indole-3-boronic acid, pinacol ester (1-(TERT-BUTOXYCARBONYL)-1H-INDOL-3-YL)BORONIC ACID PINACOL ESTER tert-Butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate tert-Butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-1-carboxylate 1H-Indole-1-carboxylic acid, 3-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-, 1,1-diMethy 1H-Indole-1-carboxylic acid, 3-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-, 1,1-diMethylethyl ester | [Molecular Formula]
C19H26BNO4 | [MDL Number]
MFCD12407262 | [MOL File]
942070-45-3.mol | [Molecular Weight]
343.23 |
| Chemical Properties | Back Directory | [Melting point ]
163-165 °C | [Boiling point ]
454.6±37.0 °C(Predicted) | [density ]
1.08±0.1 g/cm3(Predicted) | [storage temp. ]
Inert atmosphere,Store in freezer, under -20°C | [InChI]
InChI=1S/C19H26BNO4/c1-17(2,3)23-16(22)21-12-14(13-10-8-9-11-15(13)21)20-24-18(4,5)19(6,7)25-20/h8-12H,1-7H3 | [InChIKey]
WWMZOMHUEMTTQO-UHFFFAOYSA-N | [SMILES]
N1(C(OC(C)(C)C)=O)C2=C(C=CC=C2)C(B2OC(C)(C)C(C)(C)O2)=C1 |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Labex Corporation
|
| Tel: |
+91-11-26135922 or +91-11-46160359 |
| Website: |
www.labex.net |
|