| Identification | Back Directory | [Name]
Tetrapeptide-21 | [CAS]
960608-17-7 | [Synonyms]
Tetrapeptide-21 Tetrapeptide-21 USP/EP/BP 960608-17-7 Tetrapeptide-21 Glycine, glycyl-L-α-glutamyl-L-lysyl- (4S)-4-[(2-aminoacetyl)amino]-5-[[(2S)-6-amino-1-(carboxymethylamino)-1-oxohexan-2-yl]amino]-5-oxopentanoic acid | [EINECS(EC#)]
-0 | [Molecular Formula]
C15H27N5O7 | [MOL File]
960608-17-7.mol | [Molecular Weight]
389.4 |
| Chemical Properties | Back Directory | [Boiling point ]
896.1±65.0 °C(Predicted) | [density ]
1.336±0.06 g/cm3(Predicted) | [form ]
Solid | [pka]
3.29±0.10(Predicted) | [color ]
White to off-white | [Sequence]
Gly-Glu-Lys-Gly | [Cosmetics Ingredients Functions]
SKIN CONDITIONING | [InChIKey]
CUVSTAMIHSSVKL-UWVGGRQHSA-N | [SMILES]
C(O)(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(O)=O)NC(=O)CN |
| Hazard Information | Back Directory | [Description]
Tetrapeptide-21 is a tetrapeptide derived from the skin itself. It has a unique structure and can promote the synthesis of extracellular matrix, thereby reducing various wrinkles and improving skin aging. Compared with the very popular base peptide (Matrixyl) on the market, the effect of tetrapeptide-21 is more prominent. | [Uses]
Tetrapeptide-21 can effectively dilute various wrinkles, improve skin firmness, smoothness and elasticity, and is suitable for various anti-wrinkle and anti-aging care products. |
|
|