4-(3-Isopropyl-1,2,4-oxadiazol-5-yl)piperidine
|
|
|
- CAS-Nr.
- 733748-92-0
- Englisch Name:
- 4-(3-Isopropyl-1,2,4-oxadiazol-5-yl)piperidine
- Synonyma:
- 4-(3-Isopropyl-1,2,4-oxadiazol-5-yl)piperidine;3-Isopropyl-5-(piperidin-4-yl)-1,2,4-oxadiazole;5-(4-piperidinyl)-3-propan-2-yl-1,2,4-oxadiazole;Piperidine, 4-[3-(1-methylethyl)-1,2,4-oxadiazol-5-yl]-;4-(3-isopropyl-1,2,4-oxadiazol-5-yl)piperidine(SALTDATA: HCl)
- CBNumber:
- CB21474635
- Summenformel:
- C10H17N3O
- Molgewicht:
- 195.26
- MOL-Datei:
- 733748-92-0.mol
|
4-(3-Isopropyl-1,2,4-oxadiazol-5-yl)piperidine Eigenschaften
- Siedepunkt:
- 316.9±52.0 °C(Predicted)
- Dichte
- 1.049±0.06 g/cm3(Predicted)
- Brechungsindex
- 1.4860
- storage temp.
- 2-8°C
- Aggregatzustand
- solid
- pka
- 9.58±0.10(Predicted)
- Aussehen
- Colorless to light yellow Liquid
- InChI
- 1S/C10H17N3O/c1-7(2)9-12-10(14-13-9)8-3-5-11-6-4-8/h7-8,11H,3-6H2,1-2H3
- InChIKey
- QDRJZNBKSMAEIE-UHFFFAOYSA-N
- SMILES
- N1CCC(CC1)c2nc(n[o]2)C(C)C
- CAS Datenbank
- 733748-92-0
Sicherheit
- Risiko- und Sicherheitserklärung
- Gefahreninformationscode (GHS)
| Kennzeichnung gefährlicher |
Xi,T |
|
|
| R-Sätze: |
25 |
|
|
| S-Sätze: |
45 |
|
|
| WGK Germany |
3 |
|
|
| HazardClass |
IRRITANT |
|
|
| Speicherklasse |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|
|
| Hazard Classifications |
Acute Tox. 3 Oral |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Achtung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H301 |
Giftig bei Verschlucken. |
Akute Toxizität oral |
Kategorie 3 |
Achtung |
 |
P264, P270, P301+P310, P321, P330,P405, P501 |
|
| Sicherheit |
| P301+P310 |
BEI VERSCHLUCKEN: Sofort GIFTINFORMATIONSZENTRUM/Arzt/... (geeignete Stelle für medizinische Notfallversorgung vom Hersteller/Lieferanten anzugeben) anrufen. |
|
4-(3-Isopropyl-1,2,4-oxadiazol-5-yl)piperidine Chemische Eigenschaften,Einsatz,Produktion Methoden
4-(3-Isopropyl-1,2,4-oxadiazol-5-yl)piperidine Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
4-(3-Isopropyl-1,2,4-oxadiazol-5-yl)piperidine Anbieter Lieferant Produzent Hersteller Vertrieb Händler.
Global( 56)Lieferanten
- 3-Isopropyl-5-(piperidin-4-yl)-1,2,4-oxadiazole
- 4-(3-Isopropyl-1,2,4-oxadiazol-5-yl)piperidine
- 4-(3-isopropyl-1,2,4-oxadiazol-5-yl)piperidine(SALTDATA: HCl)
- 5-(4-piperidinyl)-3-propan-2-yl-1,2,4-oxadiazole
- Piperidine, 4-[3-(1-methylethyl)-1,2,4-oxadiazol-5-yl]-
- 733748-92-0