비스(트라이펩타이드-1)카퍼아세테이트
|
|
비스(트라이펩타이드-1)카퍼아세테이트 속성
- InChIKey
- VJKXESGORYEAGC-UHFFFAOYSA-K
- SMILES
- C(=O)(O)C.C(C1CC2=CNC=N2[Cu+2]2(N3C=NC(CC(NC(=O)CN)C(=O)NC(C(=O)[O-])CCCCN)=C3)NCC(=O)[N-]12)(=O)NC(C(=O)[O-])CCCCN.[H+]
- LogP
- -2.241 (est)
안전
- 위험 및 안전 성명
- 위험 및 사전주의 사항 (GHS)
| 그림문자(GHS): |
 
|
||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 신호 어: | Warning | ||||||||||||||||||||||||||||||||
| 유해·위험 문구: |
|
||||||||||||||||||||||||||||||||
| 예방조치문구: |
|
비스(트라이펩타이드-1)카퍼아세테이트 C화학적 특성, 용도, 생산
개요
Iamin gel was launched in the US for the care of chronic and acute wounds. It can be prepared by combining the tripeptide GHK and copper (Ⅱ) acetate. There are several species present in equilibrium but the biscomplex is the dominant compound at neutral pH. The GHK sequence is found in only eight human proteins and is an endogenous growth factor that stimulates collagen synthesis and angiogenesis. This is part of the explanation for its wound healing and tissue repair ability. It can significantly delay fibroblast activation, is a growth factor for hepatocyctes, neurons, thyroid follicular cells and is a chemoattractant for monocytes, macrophages, mast cells and capillary endothelial cells. Copper is also known to have an effect on lysyl oxidase which is a key enzyme involved in collagen formation.용도
anti-wrikle용도
Prezatide is used for skin care, and has the potential to treat chronic obstructive pulmonary disease and metastatic colon cancer. Prezatide copper acetate is used in personal skin care products with anti-inflammatory and anti-allergic effects, such as essence lotion, cream, facial mask and sunscreen, etcMechanism of action
Copper peptides, including Prezatide, are known for their potent biological activity, primarily due to copper's essential role in various enzymatic processes. In wound healing, Prezatide copper acetate promotes angiogenesis (the formation of new blood vessels), which is critical for supplying nutrients and oxygen to the wound site. This process is facilitated by activating growth factors such as vascular endothelial growth factor (VEGF) and transforming growth factor-beta (TGF-β). Additionally, Prezatide copper acetate exhibits significant anti-inflammatory properties. It inhibits the production of pro-inflammatory cytokines, thereby reducing inflammation and promoting a conducive environment for tissue repair. The compound also boosts the synthesis of extracellular matrix components like collagen and elastin, which are vital for maintaining skin integrity and elasticity, thus explaining its use in dermatological applications.비스(트라이펩타이드-1)카퍼아세테이트 준비 용품 및 원자재
원자재
준비 용품
비스(트라이펩타이드-1)카퍼아세테이트 공급 업체
글로벌( 140)공급 업체
| 공급자 | 전화 | 이메일 | 국가 | 제품 수 | 이점 |
|---|---|---|---|---|---|
| Hantai Biomedical Group Co. LTD | +8618819265912 |
id002@cnhantide.com | China | 37 | 58 |
| Sea Biological Co.,LTD | +86-13865152372 +86-13865152372 |
tim@sea-biol.com | China | 71 | 58 |
| Shanghai Getian Industrial Co., LTD | +86-15373193816 +86-15373193816 |
mike@ge-tian.com | China | 269 | 58 |
| Henan Tianfu Chemical Co.,Ltd. | +86-0371-55170693 +86-19937530512 |
info@tianfuchem.com | China | 21667 | 55 |
| ATK CHEMICAL COMPANY LIMITED | +undefined-21-51877795 |
ivan@atkchemical.com | China | 32836 | 60 |
| Shenzhen Nexconn Pharmatechs Ltd | +86-755-89396905 +86-15013857715 |
admin@nexconn.com | China | 10311 | 58 |
| Hebei Jimi Trading Co., Ltd. | +86 319 5273535 |
bestoneforyou@sina.com | CHINA | 288 | 58 |
| Shochem(Shanghai) Co.,Ltd | 86-21-50800795 |
info@shochem.com | CHINA | 288 | 58 |
| BOC Sciences | +1-631-485-4226 |
inquiry@bocsci.com | United States | 19553 | 58 |
| CONIER CHEM AND PHARMA LIMITED | +8618523575427 |
sales@conier.com | China | 49392 | 58 |
비스(트라이펩타이드-1)카퍼아세테이트 관련 검색:
L-카노신
Copper Peptide
N-[1-Deoxy-3,4:5,6-bis-O-(1-methylethylidene)-D-glucitol-1-yl]-N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-glutamine 2-propen-1-yl ester
H-GLY-PRO-HYP-OH
Copper tripeptide
Palmitoyl Pentapeptide
Palmitoyl Tripeptide-5
Acetyl Tetrapeptide-5
Palmitoyl Hexapeptide-12
Argireline
Tripeptide-1
TYR-D-ALA-GLY-PHE-LEU
(2S)-N2-(1-Oxohexadecyl)-L-lysyl-L-valyl-2,4-diaminobutanoic acid bis(trifluoroacetate)
Acetyl Dipeptide-1 cetyl ester
MET-GLU-HIS-PHE-ARG-TRP-GLY
H-VAL-TRP-OH
Rigin
Biotinoyl tripeptide-1