- Buspirone-D8
-
-
2026-05-11
- CAS:204395-49-3
- Purity:
- Supply Ability: 10g
|
| | BUSPIRONE (D8) Basic information |
| | BUSPIRONE (D8) Chemical Properties |
| Melting point | 198-2000C | | Fp | 9℃ | | storage temp. | -20°C | | solubility | Acetonitrile (Very Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Major Application | clinical testing | | InChI | 1S/C21H31N5O2/c27-18-16-21(6-1-2-7-21)17-19(28)26(18)11-4-3-10-24-12-14-25(15-13-24)20-22-8-5-9-23-20/h5,8-9H,1-4,6-7,10-17H2/i3D2,4D2,10D2,11D2 | | InChIKey | QWCRAEMEVRGPNT-QGZHXTQCSA-N | | SMILES | N3(CCN(CC3)c4ncccn4)C(C(C(C(N1C(=O)CC2(CCCC2)CC1=O)([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H] | | CAS DataBase Reference | 204395-49-3 |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | BUSPIRONE (D8) Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Buspirone-d8 Hydrochloride belongs to Non-benzodiazepine anxiolytic; It is a kind of 5-hydroxytryptamine (5-HT1) receptor agonist. Labeled Buspirone, intended for use as an internal standard for the quantification of Buspirone by GC- or LC-mass spectrometry. | | Uses | Non-benzodiazepine anxiolytic; 5-hydroxytryptamine (5-HT1) receptor agonist. |
| | BUSPIRONE (D8) Preparation Products And Raw materials |
|