|
|
| | Bromonordiazepam Basic information |
| Product Name: | Bromonordiazepam | | Synonyms: | 7-bromo-5-phenyl-1,2-dihydro-2H-1,4-benzodiazepin-2-one;5-Phenyl-7-bromo-1,3-dihydro-2H-1,4-benzodiazepine-2-one;7-Bromo-5-(phenyl)-1H-1,4-benzodiazepin-2(3H)-one;7-Bromo-5-phenyl-1H-1,4-benzodiazepine-2(3H)-one;7-bromo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;7-bromo-5-phenyl-1H-benzo[e][1,4]diazepin-2(3H)-one;7-Bromo-5-phenyl-1,3-dihydro-benzo[e][1,4]diazepin-2-one;7-Bromo-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-one | | CAS: | 2894-61-3 | | MF: | C15H11BrN2O | | MW: | 315.16 | | EINECS: | 200-838-9 | | Product Categories: | 2894-61-3 | | Mol File: | 2894-61-3.mol |  |
| | Bromonordiazepam Chemical Properties |
| Melting point | 220-221 °C(Solv: ethyl ether (60-29-7)) | | Boiling point | 464.8±45.0 °C(Predicted) | | density | 1.51±0.1 g/cm3(Predicted) | | solubility | DMF: 5 mg/mL; DMSO: 5 mg/mL; Ethanol: Slightly soluble; PBS (pH 7.2): 0.12 mg/mL | | form | A solid | | pka | 11.72±0.70(Predicted) | | InChI | InChI=1S/C15H11BrN2O/c16-11-6-7-13-12(8-11)15(17-9-14(19)18-13)10-4-2-1-3-5-10/h1-8H,9H2,(H,18,19) | | InChIKey | ATCCWKYKHCKDGT-UHFFFAOYSA-N | | SMILES | N1C2=CC=C(Br)C=C2C(C2=CC=CC=C2)=NCC1=O |
| | Bromonordiazepam Usage And Synthesis |
| Description | Bromonordiazepam is the active metabolite of of the Soviet developed Gidazepam. Bromonordiazepam is closely related is to Diazepam in structure, has a very long half life and is exceptionally anxiolytic with limited non-therapeutic potential. | | Uses | 7-Bromo-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-one inhibits HIV-1 reverse transcription. | | Application | Desalkylgidazepam is an analytical reference standard categorized as a benzodiazepine metabolite. Desalkylgidazepam is a metabolite of gidazepam. This product is intended for research and forensic applications. | | Definition | Bromonordiazepam, also known as BNZD or Bromo, is in the benzodiazepine drug class. It is commonly used for its anxiolytic (calming) and sedative effects. It comes from the more well-known drugs benzodiazepine and diazepam. The structure of this compound is similar to other benzodiazepines like alprazolam and lorazepam. It is derived directly from diazepam, which is a benzodiazepine that was first made in the 1950s. In general, Benzodiazepines work by improving the neurotransmitter GABA's activity in the brain. As a result, it produces relaxing and calming feelings. This drug is used for treating anxiety, insomnia, and other conditions that affect mood and cognition. However, like other benzodiazepines, it is also used recreationally for its euphoric effects.
| | Metabolism | Bromonordiazepam can take anywhere from 20 minutes to an hour to take effect. The duration of effects lasts anywhere from 6 to 12 hours, depending on the dose and individual metabolism. |
| | Bromonordiazepam Preparation Products And Raw materials |
|