| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Di-tert-butyl acetylenedicarboxylate Basic information |
| | Di-tert-butyl acetylenedicarboxylate Chemical Properties |
| Melting point | 33-37 °C(lit.) | | Boiling point | 80-82 °C0.05 mm Hg(lit.) | | density | 1.0238 (rough estimate) | | refractive index | 1.4560 (estimate) | | Fp | >230 °F | | storage temp. | 2-8°C | | form | solid | | Appearance | Colorless to off-white Solid | | BRN | 1957547 | | InChI | 1S/C12H18O4/c1-11(2,3)15-9(13)7-8-10(14)16-12(4,5)6/h1-6H3 | | InChIKey | FBCRUXRGQFLOMC-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)C#CC(=O)OC(C)(C)C |
| Hazard Codes | C | | Risk Statements | 34-36/37 | | Safety Statements | 26-27-28-36/37/39-45 | | RIDADR | UN 3261 8/PG 3 | | WGK Germany | 3 | | F | 8 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
| | Di-tert-butyl acetylenedicarboxylate Usage And Synthesis |
| Uses | The cross-cyclotrimerization of di-tert-butyl acetylenedicarboxylate, silylacetylenes and acrylamides was studied with cationic rhodium(I)/(R)-tol-binap complex as catalyst. Glycosyl azides were subjected to 1,3-dipolar cycloaddition with di-tert-butyl acetylenedicarboxylate. | | General Description | The cross-cyclotrimerization of di-tert-butyl acetylenedicarboxylate, silylacetylenes and acrylamides was studied with cationic rhodium(I)/(R)-tol-binap complex as catalyst. Glycosyl azides were subjected to 1,3-dipolar cycloaddition with di-tert-butyl acetylenedicarboxylate. |
| | Di-tert-butyl acetylenedicarboxylate Preparation Products And Raw materials |
|