|
|
| | 2-(3,4-epoxycyclohexyl)ethylmethyldiethosysilane Basic information |
| Product Name: | 2-(3,4-epoxycyclohexyl)ethylmethyldiethosysilane | | Synonyms: | 2-(3,4-epoxycyclohexyl)ethylmethyldiethosysilane;(2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl)diethoxy(Methyl)silane;2-(3,4-EPOXYCYCLOHEXYL)ETHYLMETHYLDIETHOXYSILANE;3-[2-(Diethoxymethylsilyl)ethyl]-7-oxabicyclo[4.1.0]heptane;7-Oxabicyclo[4.1.0]heptane, 3-[2-(diethoxymethylsilyl)ethyl]-;(2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl)diethoxy(methyl)sil... | | CAS: | 14857-35-3 | | MF: | C13H26O3Si | | MW: | 258.43 | | EINECS: | | | Product Categories: | | | Mol File: | 14857-35-3.mol |  |
| | 2-(3,4-epoxycyclohexyl)ethylmethyldiethosysilane Chemical Properties |
| Boiling point | 114-117 °C(Press: 1 Torr) | | density | 0.9312 g/cm3 | | refractive index | 1.4248 | | Specific Gravity | 0.976 | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | InChI=1S/C13H26O3Si/c1-3-14-13(15-4-2)17-8-7-10-5-6-11-12(9-10)16-11/h10-13H,3-9,17H2,1-2H3 | | InChIKey | YJXINAHEEGBIDZ-UHFFFAOYSA-N | | SMILES | C12C(O1)CCC(CC[SiH2]C(OCC)OCC)C2 |
| | 2-(3,4-epoxycyclohexyl)ethylmethyldiethosysilane Usage And Synthesis |
| | 2-(3,4-epoxycyclohexyl)ethylmethyldiethosysilane Preparation Products And Raw materials |
|